|
|
| | 2-Amino-3-trifluoromethylbenzonitrile Basic information |
| | 2-Amino-3-trifluoromethylbenzonitrile Chemical Properties |
| Melting point | 62-65 °C | | Boiling point | 263.9±40.0 °C(Predicted) | | density | 1.37±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | form | Solid | | pka | -1.32±0.10(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C8H5F3N2/c9-8(10,11)6-3-1-2-5(4-12)7(6)13/h1-3H,13H2 | | InChIKey | UHOSMRSMWHLHJO-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=CC(C(F)(F)F)=C1N | | CAS DataBase Reference | 58458-14-3(CAS DataBase Reference) |
| | 2-Amino-3-trifluoromethylbenzonitrile Usage And Synthesis |
| Uses | 2-Amino-3-trifluoromethylbenzonitrile is a useful intermediate for the preparation of chloro and trifluoromethyl derivatives of benzisothiazoles. | | Synthesis Reference(s) | Journal of Heterocyclic Chemistry, 17, p. 65, 1980 DOI: 10.1002/jhet.5570170113 |
| | 2-Amino-3-trifluoromethylbenzonitrile Preparation Products And Raw materials |
|