Ethyl-d5 Vanillin manufacturers
|
| | Ethyl-d5 Vanillin Basic information |
| Product Name: | Ethyl-d5 Vanillin | | Synonyms: | Ethyl-d5 Vanillin;Ethyl Vanillin-d5;3-[(1,1,2,2,2-2H?)ethoxy]-4-hydroxybenzaldehyde;3-(Ethoxy-d5)-4-hydroxybenzaldehyde , Ethylvanillin-d5;D5-Ethyl Vanillin;Ethyl-D5 Vanillin (Standard) | | CAS: | 1335401-74-5 | | MF: | C9H10O3 | | MW: | 166.18 | | EINECS: | | | Product Categories: | | | Mol File: | 1335401-74-5.mol |  |
| | Ethyl-d5 Vanillin Chemical Properties |
| Melting point | 75-78°C | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | InChI=1S/C9H10O3/c1-2-12-9-5-7(6-10)3-4-8(9)11/h3-6,11H,2H2,1H3 | | InChIKey | CBOQJANXLMLOSS-UHFFFAOYSA-N | | SMILES | O(C1C(=CC=C(C=O)C=1)O)C([H])([H])C([H])([H])[H] |
| | Ethyl-d5 Vanillin Usage And Synthesis |
| Uses | Ethyl-d5 Vanillin is the isotope analog of ethyl vanillin. Ethyl Vanillin, is used as a flavorant, which is about three times as potent as vanillin (V097500) and can be utilized in the production of chocolate. It has also shown to have antioxidant properties. |
| | Ethyl-d5 Vanillin Preparation Products And Raw materials |
|