| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Fmoc-L-HomoPro(4-oxo) Basic information |
| Product Name: | Fmoc-L-HomoPro(4-oxo) | | Synonyms: | (S)-1-Fmoc-4-oxohomoproline;(S)-1-Fmoc-4-oxopiperidine-2-carboxylic acid;Fmoc-L-Homopro(4-oxo)-OH;(2S)-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}-4-oxopiperidine-2-carboxylic acid;1,2-Piperidinedicarboxylic acid, 4-oxo-, 1-(9H-fluoren-9-ylmethyl) ester, (2S)-;(S)-(-)-1-Fmoc-4-oxopiperidine-2-carboxylicacid,97%;(2S)-Fmoc-4-Oxo-Pic(2)-OH;(S)-1-Fmoc-4-oxopiperidine-2-carboxylic acid | | CAS: | 1221793-43-6 | | MF: | C21H19NO5 | | MW: | 365.38 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | Fmoc-L-HomoPro(4-oxo) Chemical Properties |
| Melting point | 228-223℃ | | storage temp. | 2-8°C | | form | Powder | | color | White to yellow | | Sensitive | Moisture Sensitive | | InChI | 1S/C21H19NO5/c23-13-9-10-22(19(11-13)20(24)25)21(26)27-12-18-16-7-3-1-5-14(16)15-6-2-4-8-17(15)18/h1-8,18-19H,9-12H2,(H,24,25)/t19-/m0/s1 | | InChIKey | YGAHCGORXONSSM-IBGZPJMESA-N | | SMILES | OC(=O)[C@@H]1CC(=O)CCN1C(=O)OCC2c3ccccc3-c4ccccc24 |
| Hazard Codes | N | | Risk Statements | 50 | | Safety Statements | 61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 |
| | Fmoc-L-HomoPro(4-oxo) Usage And Synthesis |
| | Fmoc-L-HomoPro(4-oxo) Preparation Products And Raw materials |
|