|
|
| | Dodecanoic-d23 acid Basic information |
| | Dodecanoic-d23 acid Chemical Properties |
| Melting point | 44-46 °C(lit.) | | Boiling point | 225 °C100 mm Hg(lit.) | | Fp | 113 °C | | solubility | DMF: 30 mg/ml; DMSO: 20 mg/ml; Ethanol: 30 mg/ml | | form | A crystalline solid | | color | White to off-white | | InChI | 1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14)/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2 | | InChIKey | POULHZVOKOAJMA-SJTGVFOPSA-N | | SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(O)=O | | CAS Number Unlabeled | 143-07-7 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-28 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 |
| | Dodecanoic-d23 acid Usage And Synthesis |
| Uses | Labeled Lauric Acid which may be used in combination with drug loading to reduce side effects, such as irritation with clarithromycin. | | Uses | This product may be used as an analytical standard. |
| | Dodecanoic-d23 acid Preparation Products And Raw materials |
|