|
|
| | DODECANOIC-2,2-D2 ACID Basic information |
| Product Name: | DODECANOIC-2,2-D2 ACID | | Synonyms: | 2,2-DIDEUTERODODECANOIC ACID;Dodecanoic-d2 Acid;LAURIC-2,2-D2 ACID;DODECANOIC-2,2-D2 ACID;DODECANOIC ACID-2,2-D2;LAURIC-2,2-D2 ACID, 98 ATOM % D;Dodecanedioic-2,2-D2 Acid;Lauric-2,2-d2 acid | | CAS: | 64118-39-4 | | MF: | C12H22D2O2 | | MW: | 202.33 | | EINECS: | | | Product Categories: | | | Mol File: | 64118-39-4.mol |  |
| | DODECANOIC-2,2-D2 ACID Chemical Properties |
| Melting point | 44-46 °C(lit.) | | Boiling point | 225 °C100 mm Hg(lit.) | | Fp | 113 °C | | solubility | DMF: 30 mg/ml; DMSO: 20 mg/ml; Ethanol: 30 mg/ml | | form | A solid | | InChI | 1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14)/i11D2 | | InChIKey | POULHZVOKOAJMA-ZWGOZCLVSA-N | | SMILES | [2H]C([2H])(CCCCCCCCCC)C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-28 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 |
| | DODECANOIC-2,2-D2 ACID Usage And Synthesis |
| Uses | Dodecanoic-2,2-d2 Acid (CAS# 64118-39-4) is a useful isotopically labeled research compound. |
| | DODECANOIC-2,2-D2 ACID Preparation Products And Raw materials |
|