| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | (4-Methyl-pyridin-2-yl)-carbamic acid tert-butyl ester Basic information |
| Product Name: | (4-Methyl-pyridin-2-yl)-carbamic acid tert-butyl ester | | Synonyms: | tert-butyl N-(4-methylpyridin-2-yl)carbamate;2-(BOC-AMINO)-4-METHYLPYRIDINE;TERT-BUTYL 4-METHYLPYRIDIN-2-YLCARBAMATE;Carbamic acid, (4-methyl-2-pyridinyl)-, 1,1-dimethylethyl ester (9CI);N-(4-methyl-2-pyridyl)carbamic acid tert-butyl ester;CarbaMic acid, (4-Methyl-2-pyridinyl)-, 1,1-diMethylethyl ester;N-(4-methyl-2-pyridinyl)carbamic acid tert-butyl ester;tert-butyl N-(4-methyl-2-pyridyl)carbamate | | CAS: | 90101-20-5 | | MF: | C11H16N2O2 | | MW: | 208.26 | | EINECS: | | | Product Categories: | N-BOC;pharmacetical | | Mol File: | 90101-20-5.mol |  |
| | (4-Methyl-pyridin-2-yl)-carbamic acid tert-butyl ester Chemical Properties |
| Melting point | 118-119℃ | | Boiling point | 274.2±28.0 °C(Predicted) | | density | 1.108±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder to crystal | | pka | 12.56±0.70(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C11H16N2O2/c1-8-5-6-12-9(7-8)13-10(14)15-11(2,3)4/h5-7H,1-4H3,(H,12,13,14) | | InChIKey | SABMAMDNSRZJBK-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NC1=NC=CC(C)=C1 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | HazardClass | IRRITANT | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | (4-Methyl-pyridin-2-yl)-carbamic acid tert-butyl ester Usage And Synthesis |
| | (4-Methyl-pyridin-2-yl)-carbamic acid tert-butyl ester Preparation Products And Raw materials |
|