| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:cis-1,5-Cyclooctanediol
CAS:23418-82-8
Purity:98% Package:10G,50G
|
| Company Name: |
Suzhou Lakestar Pharmatech Co., Ltd.
|
| Tel: |
0512-63970158-603 18018108880 |
| Email: |
info@lakestarpharma.com |
| Products Intro: |
Product Name:CIS-1,5-CYCLOOCTANEDIOL
CAS:23418-82-8
Purity:0.97 Package:10g;25g;100g;500g
|
|
| | CIS-1,5-CYCLOOCTANEDIOL Basic information |
| | CIS-1,5-CYCLOOCTANEDIOL Chemical Properties |
| Melting point | 73-75 °C (lit.) | | Boiling point | 105-107 °C/0.05 mmHg (lit.) | | density | 0.9730 (rough estimate) | | refractive index | 1.5100 (estimate) | | pka | 14.85±0.40(Predicted) | | form | solid | | InChI | InChI=1S/C8H16O2/c9-7-3-1-4-8(10)6-2-5-7/h7-10H,1-6H2/t7-,8+ | | InChIKey | BDNXUVOJBGHQFD-OCAPTIKFSA-N | | SMILES | [C@@H]1(O)CCC[C@H](O)CCC1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | CIS-1,5-CYCLOOCTANEDIOL Usage And Synthesis |
| Uses | cis-1,5-Cyclooctanediol was used in the synthesis of cis-1,5-diaminocyclooctane. |
| | CIS-1,5-CYCLOOCTANEDIOL Preparation Products And Raw materials |
|