|
|
| | 13-Acetyl-9-dihydrobaccatin III Basic information |
| Product Name: | 13-Acetyl-9-dihydrobaccatin III | | Synonyms: | Cabazitaxel Impurity 55;9-Dideacetyl baccatin VI;2a,3,4,4a,5,6,9,10,12,12a-Decahydro-4a,8,13,13-tetramethyl-7,11-methano-1H-cyclodeca[3,4]benz[1,2-b]oxete-4,5,6,9,11,12,12b-heptol (2aR,4S,4aS,5R,6R,9S,11S,12S,12aR,12bS)-6,9,12b-triacetate 12-benzoate;13-Acetyl-9-dihydrobaccatin III;9-Dihydro-13-acetylbaccatinIII from Taxus canadensis;9-DIHYDRO-13-ACETYL BACCATIN(9-DHB);7,9-Dideacetylbaccatin VI;19-DHB | | CAS: | 142203-65-4 | | MF: | C33H42O12 | | MW: | 630.68 | | EINECS: | | | Product Categories: | Miscellaneous Natural Products | | Mol File: | 142203-65-4.mol |  |
| | 13-Acetyl-9-dihydrobaccatin III Chemical Properties |
| Melting point | 171-175°C | | Boiling point | 704.5±60.0 °C(Predicted) | | density | 1.36±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 12.61±0.70(Predicted) | | form | Solid | | color | White | | InChIKey | WPPPFZJNKLMYBW-FAEUQDRCSA-N | | SMILES | O1C[C@@]2(OC(=O)C)[C@@]3([H])[C@H](OC(=O)C4=CC=CC=C4)[C@@]4(O)C(C)(C)C(=C(C)[C@@H](OC(=O)C)C4)[C@@H](OC(=O)C)[C@H](O)[C@]3(C)[C@@H](O)C[C@@]12[H] |
| RIDADR | 1544 | | WGK Germany | 3 | | HazardClass | 6.1(b) | | PackingGroup | III |
| | 13-Acetyl-9-dihydrobaccatin III Usage And Synthesis |
| Description | 13-acetyl-9-Dihydrobaccatin III is a taxane originally isolated from T. canadensis. It inhibits proliferation of P388 leukemia cells with an IC50 value of 20 μg/ml. | | Chemical Properties | White crystalline powder, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from Taxus chinensis. | | Uses | 13-Acetyl-9-dihydrobaccatin-III is an apoptosis inducer. | | References | [1] GEEWANANDA P. GUNAWARDANA. Isolation of 9-Dihydro-13-acetylbaccatin III from Taxus canadensis[J]. Journal of Natural Products , 1992, 55 11: 1686-1689. DOI: 10.1021/np50089a022 |
| | 13-Acetyl-9-dihydrobaccatin III Preparation Products And Raw materials |
|