|
|
| | 3-Trifluoromethyl-4-bromobenzonitrile Basic information |
| Product Name: | 3-Trifluoromethyl-4-bromobenzonitrile | | Synonyms: | 4-Chloro-3,5-dibromo-(difluoromethoxy)benzene;3-TRIFLUOROMETHYL-4-BROMO BENZONITRILE;4-BROMO-3-(TRIFLUOROMETHYL)BENZONITRILE;Benzonitrile, 4-bromo-3-(trifluoromethyl)-;4-Bromo-3-(trifluoromethyl)benzonitrile 97%;2-Bromo-5-cyanobenzotrifluoride;2-Bromo-5-cyanobenzotrifluoride, 4-Bromo-alpha,alpha,alpha-trifluoro-m-tolunitrile;4-Bromo-3-(trifluoromethyl)benzonitrile > | | CAS: | 1735-53-1 | | MF: | C8H3BrF3N | | MW: | 250.02 | | EINECS: | | | Product Categories: | Nitrile | | Mol File: | 1735-53-1.mol |  |
| | 3-Trifluoromethyl-4-bromobenzonitrile Chemical Properties |
| Melting point | 80.0 to 84.0 °C | | Boiling point | 235.6±35.0 °C(Predicted) | | density | 1.71±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to lump | | color | Light orange to Yellow to Green | | InChI | InChI=1S/C8H3BrF3N/c9-7-2-1-5(4-13)3-6(7)8(10,11)12/h1-3H | | InChIKey | KSXUIQQDHHFSRN-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=C(Br)C(C(F)(F)F)=C1 | | CAS DataBase Reference | 1735-53-1(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | RIDADR | UN 3439 6.1/PG III | | Hazard Note | Harmful | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2926907090 |
| | 3-Trifluoromethyl-4-bromobenzonitrile Usage And Synthesis |
| Chemical Properties | light yellow solid | | Uses | 3-Trifluoromethyl-4-bromobenzonitrile is an important organic synthesis intermediate used in dyes and pharmaceutical raw materials. |
| | 3-Trifluoromethyl-4-bromobenzonitrile Preparation Products And Raw materials |
|