- 4-METHYLRESORCINOL
-
- $30.00
-
2026-08-07
- CAS:496-73-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 3000KG
- 4-METHYLRESORCINOL
-
-
2026-06-30
- CAS:496-73-1
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
|
| | 4-METHYLRESORCINOL Basic information |
| | 4-METHYLRESORCINOL Chemical Properties |
| Melting point | 104-108 °C | | Boiling point | 264℃ | | density | 1.210 | | refractive index | 1.4922 (estimate) | | Fp | 130℃ | | storage temp. | Sealed in dry,Room Temperature | | pka | 10.05±0.18(Predicted) | | form | solid | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C7H8O2/c1-5-2-3-6(8)4-7(5)9/h2-4,8-9H,1H3 | | InChIKey | FNYDIAAMUCQQDE-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(C)C(O)=C1 | | EPA Substance Registry System | 1,3-Benzenediol, 4-methyl- (496-73-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2907290090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-METHYLRESORCINOL Usage And Synthesis |
| Uses | 4-Methylbenzene-1,3-diol is a useful research chemical used in the synthesis of (3'R,4'R)-(+)-cis-khellactone derivatives as novel, potent anti-HIV agents. |
| | 4-METHYLRESORCINOL Preparation Products And Raw materials |
|