|
|
| | 1-METHYL-4-[4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL]PIPERAZINE Basic information |
| Product Name: | 1-METHYL-4-[4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL]PIPERAZINE | | Synonyms: | 1-METHYL-4-[4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL]PIPERAZINE;4-(4-METHYLPIPERAZIN-1-YL)PHENYLBORONIC ACID, PINACOL ESTER;1-Methyl-4-[4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]poperazine;4-(4-Methyl-1-piperazinyl)benzeneboronic acid pinacol ester;1-Methyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine;4-(4-Methylpiperazin-1-yl)benzeneboronic acid, pinacol ester;4-(4-Methyl-1-piperazinyl)phenylboronic Acid Pinacol Ester;1-Methyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine, 2-[4-(4-Methylpiperazin-1-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | | CAS: | 747413-21-4 | | MF: | C17H27BN2O2 | | MW: | 302.22 | | EINECS: | | | Product Categories: | | | Mol File: | 747413-21-4.mol | ![1-METHYL-4-[4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL]PIPERAZINE Structure](CAS/GIF/747413-21-4.gif) |
| | 1-METHYL-4-[4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL]PIPERAZINE Chemical Properties |
| Melting point | 112-114°C | | Boiling point | 419.2±40.0 °C(Predicted) | | density | 1.07 | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | 7.78±0.42(Predicted) | | Appearance | White to off-white Solid | | Water Solubility | Insoluble in water. | | InChI | 1S/C17H27BN2O2/c1-16(2)17(3,4)22-18(21-16)14-6-8-15(9-7-14)20-12-10-19(5)11-13-20/h6-9H,10-13H2,1-5H3 | | InChIKey | RDFJBDMCBVSCFI-UHFFFAOYSA-N | | SMILES | B3(OC(C(O3)(C)C)(C)C)c1ccc(cc1)N2CCN(CC2)C |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | HS Code | 2934100090 | | Storage Class | 11 - Combustible Solids |
| | 1-METHYL-4-[4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL]PIPERAZINE Usage And Synthesis |
| Uses | 4-(4-Methyl-1-piperazinyl)benzeneboronic acid pinacol ester is used as pharmaceutical intermediate. |
| | 1-METHYL-4-[4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL]PIPERAZINE Preparation Products And Raw materials |
|