| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
D(+)-Glucopyranose 6-phosphate monopotassium salt manufacturers
|
| | D(+)-Glucopyranose 6-phosphate monopotassium salt Basic information |
| Product Name: | D(+)-Glucopyranose 6-phosphate monopotassium salt | | Synonyms: | ROBISON ESTER MONOPOTASSIUM SALT;D-GLUCOSE 6-PHOSPHATE MONOPOTASSIUM SALT;D-GLUCOSE 6-PHOSPHATE MONOPOTASSIUM;d(+)-glucopyranose 6-phosphate potassium salt;d-glucose 6-phosphate potassium salt;D(+)-Glucopyranose 6-phosphate potassium salt, Robison ester;DGlucose 6phosphate potassium salt,D Glucose 6 phosphate potassium salt;D-Glucopyranose,6-(dihydrogen phosphate), monopotassium salt (9CI) | | CAS: | 103192-55-8 | | MF: | C6H13O9P.K | | MW: | 299.23 | | EINECS: | | | Product Categories: | | | Mol File: | 103192-55-8.mol |  |
| | D(+)-Glucopyranose 6-phosphate monopotassium salt Chemical Properties |
| storage temp. | −20°C | | solubility | water: 50 mg/mL, clear to hazy, colorless | | form | powder | | color | white | | InChI | 1S/C6H13O9P.K.H/c7-3-2(1-14-16(11,12)13)15-6(10)5(9)4(3)8;;/h2-10H,1H2,(H2,11,12,13);; | | InChIKey | UTZCQRPSJJQUEE-UHFFFAOYSA-N | | SMILES | [K].OC1OC(COP(O)(O)=O)C(O)C(O)C1O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | D(+)-Glucopyranose 6-phosphate monopotassium salt Usage And Synthesis |
| Uses | D-Glucose 6-phosphate potassium is a biologically active compound that has the activity of being a substrate for glucose-6-phosphate isomerase. D-Glucose 6-phosphate potassium can participate in the sugar metabolism process and promote the production and utilization of energy in cells. |
| | D(+)-Glucopyranose 6-phosphate monopotassium salt Preparation Products And Raw materials |
|