D(+)-Glucopyranose 6-phosphate manufacturers
|
| | D(+)-Glucopyranose 6-phosphate Basic information |
| Product Name: | D(+)-Glucopyranose 6-phosphate | | Synonyms: | (2R,3R,4S,5R)-2,3,4,5-Tetrahydroxy-6-oxohexyl dihydrogen phosphate;-2,3,4,5-Tetrahydroxy-6-oxohexyl dihydrogen phosphate;D-Glucose 6-phosphate - Powder;D-Glucose-6-phosphate - 1M, in H2O;d-glucose,6-(dihydrogenphosphate);ROBISON ESTER;D-Glucose 6-phosphate solution;D-glucose 6-phosphate free acid | | CAS: | 56-73-5 | | MF: | C6H13O9P | | MW: | 260.14 | | EINECS: | 200-286-9 | | Product Categories: | | | Mol File: | 56-73-5.mol |  |
| | D(+)-Glucopyranose 6-phosphate Chemical Properties |
| storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | Methanol (Soluble), Water (Soluble) | | form | Clear Colourless Solution | | Boiling point | 667.8±65.0 °C(Predicted) | | density | 1.832±0.06 g/cm3(Predicted) | | pKa | 1.84±0.10(Predicted) | | color | Colorless to light yellow | | Optical Rotation | +35.7 | | InChI | 1S/C6H13O9P/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14/h1,3-6,8-11H,2H2,(H2,12,13,14) | | InChIKey | VFRROHXSMXFLSN-UHFFFAOYSA-N | | SMILES | OC(COP(O)(O)=O)C(O)C(O)C(O)C=O | | EPA Substance Registry System | D-Glucose, 6-(dihydrogen phosphate) (56-73-5) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 1760 8/PG 2 | | WGK Germany | 3 | | RTECS | LZ7160000 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29400090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | D(+)-Glucopyranose 6-phosphate Usage And Synthesis |
| Chemical Properties | Clear colorless liquid | | Uses | D-Glucose 6-phosphate solution is a sarcoendoplasmic reticulum calcium ATPase activity inhibitor. | | Definition | A constituent of resting muscle and an important intermediate in carbohydrate metabolism. | | IC 50 | Human Endogenous Metabolite |
| | D(+)-Glucopyranose 6-phosphate Preparation Products And Raw materials |
|