| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Ethyltriphenylphosphonium acetate Basic information |
| Product Name: | Ethyltriphenylphosphonium acetate | | Synonyms: | ethyltriphenyl-phosphoniuacetate;Phosphonium,ethyltriphenyl-,acetate;ETHYLTRIPHENYLPHOSPHONIUM ACETATE;ETHYLTRIPHENYLPHOSPHONIUM ACID ACETATE;ETTPPAAC;ethyl Triphenyl Phosphonium Acetate 65% solution;ETHYLTRIPHENYLPHOSPHONIUM ACETATE, 70% IN METHANOL;ETHYL TRIPHENYL PHOSPHONIUM ACETATE 65% IN ETHANOL | | CAS: | 35835-94-0 | | MF: | C22H23O2P | | MW: | 350.39 | | EINECS: | 252-743-7 | | Product Categories: | | | Mol File: | 35835-94-0.mol |  |
| | Ethyltriphenylphosphonium acetate Chemical Properties |
| Boiling point | 275℃[at 101 325 Pa] | | density | 1.05 | | vapor pressure | 0Pa at 25℃ | | Fp | -17°(0°F) | | form | Liquid | | color | Yellow to dark brown | | Water Solubility | Soluble in water, alcohol. | | InChI | InChI=1S/C20H20P.C2H4O2/c1-2-21(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20;1-2(3)4/h3-17H,2H2,1H3;1H3,(H,3,4)/q+1;/p-1 | | InChIKey | HZZUMXSLPJFMCB-UHFFFAOYSA-M | | SMILES | [P+](C1C=CC=CC=1)(C1C=CC=CC=1)(CC)C1C=CC=CC=1.C([O-])(=O)C | | LogP | -0.64 at 23.5℃ | | CAS DataBase Reference | 35835-94-0(CAS DataBase Reference) | | EPA Substance Registry System | Phosphonium, ethyltriphenyl-, acetate (35835-94-0) |
| RIDADR | UN1993 | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | II |
| Provider | Language |
|
ALFA
| English |
| | Ethyltriphenylphosphonium acetate Usage And Synthesis |
| Description | Ethyltriphenylphosphonium Acetate, also known as ETPAAC, ETPAACc and TEPA, is a colourless to slightly yellow liquid with the chemical formula C22H23O2P. This quaternary phosphonium salt is available in a 70% by-weight solution in methanol. Notably, one mole of acetic acid is bound to each mole of ETPAAC. Furthermore, the material is mainly used for advancing and curing phenolic-based epoxy resins and serving as a phase transfer catalyst. Compared to amines, imidazoles, and quaternary ammonium salts, Ethyltriphenylphosphonium Acetate has considerably better latency and thermal stability. Further, it offers a low odour, minimal colour formation and controlled reactivity.
| | Uses | Ethyltriphenylphosphonium acetate is mainly used to advance and cure phenolic-based epoxy resins and as a phase transfer catalyst. It exhibits considerably better latency and thermal stability when compared to amines, imidazoles and quaternary ammonium salts. Furthermore, it has minimal odour, colour formation, and controlled reactivity. It decreases or eliminates side reactions and creates longer, straighter chain epoxy molecules with sharp molecular weight distribution.
| | Precautions | Store Ethyltriphenylphosphonium Acetate in a cool, dry, and well-ventilated area to ensure compliance with legal requirements. Keep ETPAAC away from heat sources and oxidizing agents to maintain safety and stability.
|
| | Ethyltriphenylphosphonium acetate Preparation Products And Raw materials |
|