| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Hexa-L-tyrosine Basic information |
| Product Name: | Hexa-L-tyrosine | | Synonyms: | TYR-TYR-TYR-TYR-TYR-TYR;TYR-TYR-TYR-TYR-TYR-TYR 90%;tyr-tyr-tyr-tyr-tyr-tyr90%;Hexa -Tyrosine;H-Tyr-Tyr-Tyr-Tyr-Tyr-Tyr-OH;L-Tyrosine, L-tyrosyl-L-tyrosyl-L-tyrosyl-L-tyrosyl-L-tyrosyl-;pE-MAVKKYLNSILN-NH2;Hexa-L-Tyr | | CAS: | 6934-38-9 | | MF: | C54H56N6O13 | | MW: | 997.05 | | EINECS: | | | Product Categories: | | | Mol File: | 6934-38-9.mol |  |
| | Hexa-L-tyrosine Chemical Properties |
| Boiling point | 1435.0±65.0 °C(Predicted) | | density | 1.402±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 3.07±0.10(Predicted) | | form | powder | | color | white | | InChIKey | JUUZKZKBBSFAAT-UHFFFAOYSA-N | | SMILES | NC(Cc1ccc(O)cc1)C(=O)NC(Cc2ccc(O)cc2)C(=O)NC(Cc3ccc(O)cc3)C(=O)NC(Cc4ccc(O)cc4)C(=O)NC(Cc5ccc(O)cc5)C(=O)NC(Cc6ccc(O)cc6)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Hexa-L-tyrosine Usage And Synthesis |
| Uses | Hexa-L-Tyrosine is a tyrosine derivative[1]. | | References | [1] Luckose F, et al. Effects of amino acid derivatives on physical, mental, and physiological activities. Crit Rev Food Sci Nutr. 2015;55(13):1793-1144. DOI:10.1080/10408398.2012.708368 |
| | Hexa-L-tyrosine Preparation Products And Raw materials |
|