| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3,5-Dimethylacetophenone Basic information | | Uses |
| Product Name: | 3,5-Dimethylacetophenone | | Synonyms: | 3,5-DiMethylacetoph;3',5'-DiMethylacetophenone, 98%+;1-(3,5-Dimethylphenyl)ethanone;2-[[1-(2-methylphenyl)-5-tetrazolyl]thio]-N-[4-(4-methylsulfonyl-1-piperazinyl)phenyl]acetamide;3',5'-Dimethylacetophenone>Ethanone, 1-(3,5-dimethylphenyl)-;3,5-Dimethylacetophenon;3',5'-Dimethylacetophenone | | CAS: | 5379-16-8 | | MF: | C10H12O | | MW: | 148.2 | | EINECS: | 676-296-6 | | Product Categories: | Pyridines, Pyrimidines, Purines and Pteredines | | Mol File: | 5379-16-8.mol |  |
| | 3,5-Dimethylacetophenone Chemical Properties |
| Melting point | 20°C | | Boiling point | 98-100°C 8mm | | density | 0,988 g/cm3 | | refractive index | 1.5290 | | Fp | 98-100°C/8mm | | storage temp. | Sealed in dry,Room Temperature | | form | powder to lump to clear liquid | | color | White or Colorless to Almost white or Almost colorless | | λmax | 251nm(MeOH)(lit.) | | BRN | 2240987 | | InChI | InChI=1S/C10H12O/c1-7-4-8(2)6-10(5-7)9(3)11/h4-6H,1-3H3 | | InChIKey | BKIHFZLJJUNKMZ-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC(C)=CC(C)=C1)C |
| Safety Statements | 24/25 | | HS Code | 2914390090 |
| Provider | Language |
|
ALFA
| English |
| | 3,5-Dimethylacetophenone Usage And Synthesis |
| Uses | 3,5-Dimethylacetophenone is used in organic synthesis and can be used in laboratory research and development processes as well as in chemical and pharmaceutical synthesis. | | Synthesis | To a stirred solution of 1-iodo-3,5-dimethylbenzene (2.0 g, 8.61 mmol) in 40 mL of anhydrous DMF (degassed with argon) were sequentially added LiCl (1.80 g, 43.00 mmol), Pd(dba)3 (98.6 mg, 0.11 mmol), EtNPr2 (2.95 mL, 17.23 mmol ) and acetic anhydride (2.5 mL). After degassing the reaction flask with argon, the mixture was stirred and reacted at 100 °C for 7 hours. The progress of the reaction was monitored by thin layer chromatography (TLC). Upon completion of the reaction, the mixture was cooled to room temperature and subsequently subjected to standard ether treatment to yield 1.4 g of the target product 3,5-dimethylacetophenone as a liquid, which was used directly in the next step of the reaction without further purification. Nuclear magnetic resonance (NMR) and mass spectrometry (MS) analysis confirmed that the target compound had been successfully synthesized. | | References | [1] Organic Letters, 2003, vol. 5, # 3, p. 289 - 291 [2] Patent: WO2017/9651, 2017, A1. Location in patent: Page/Page column 57 |
| | 3,5-Dimethylacetophenone Preparation Products And Raw materials |
|