|
|
| | Tris(dibenzylideneacetone)dipalladium Basic information |
| Product Name: | Tris(dibenzylideneacetone)dipalladium | | Synonyms: | PALLADIUM(0) BIS(DIBENZYLIDENEACETONE);PALLADIUM (0) BIS(DIBENZYLIDENEACETONE) SALT;PD(DBA)2;BIS(DIBENZYLIDENEACETONE) PALLADIUM(0);tris(dibenzylideneacetone)dipalladium(o)(pd2(dba)3);Tris(dibenzylideneacetone)dipalladium(0) [20% Pd];Bis(dibenzylideneacetone)dipalladium;Pd(dba)3 | | CAS: | 52409-22-0 | | MF: | C51H42O3Pd2 | | MW: | 915.71738 | | EINECS: | 620-687-6 | | Product Categories: | Catalysts-Ligands | | Mol File: | 52409-22-0.mol |  |
| | Tris(dibenzylideneacetone)dipalladium Chemical Properties |
| Melting point | 152-155 °C(lit.) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | InChI | InChI=1S/2C17H14O.Pd/c2*18-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16;/h2*1-14H;/b2*13-11+,14-12+; | | InChIKey | UKSZBOKPHAQOMP-SVLSSHOZSA-N | | SMILES | [Pd].C(=C/C1=CC=CC=C1)\C(/C=C/C1=CC=CC=C1)=O.C(=C/C1=CC=CC=C1)\C(/C=C/C1=CC=CC=C1)=O | | CAS DataBase Reference | 52409-22-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 22-24/25 | | WGK Germany | 3 |
| | Tris(dibenzylideneacetone)dipalladium Usage And Synthesis |
| Uses | Tris(dibenzylideneacetone)dipalladium is used as a source of soluble Pd(0), in particular as a catalyst for various coupling reactions. Examples of reactions using this reagent are the Negishi coupling, Suzuki coupling, Carroll rearrangement, and Trost asymmetric allylic alkylation, as well as Buchwald–Hartwig amination | | Synthesis | A process for the preparation of tris(dibenzylideneacetone)dipalladium (chloroform) comprising the steps of:
(a) reacting a Pd(II) complex with an alkali metal halide in at least one alcohol solvent; and
(b) reacting the product of step (a) with a mixture comprising dibenzylideneacetone, chloroform and an inorganic base to form Pd2(dba)3.CHCl3. |
| | Tris(dibenzylideneacetone)dipalladium Preparation Products And Raw materials |
|