| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-Carboxy-3-chlorophenylboronic acid Basic information |
| | 4-Carboxy-3-chlorophenylboronic acid Chemical Properties |
| Melting point | 236-238 | | Boiling point | 429.2±55.0 °C(Predicted) | | density | 0,88 g/cm | | storage temp. | Inert atmosphere,2-8°C | | pka | 2.82±0.25(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | 1S/C7H6BClO4/c9-6-3-4(8(12)13)1-2-5(6)7(10)11/h1-3,12-13H,(H,10,11) | | InChIKey | QFAFGWXQNDYXPZ-UHFFFAOYSA-N | | SMILES | OB(C1=CC=C(C(O)=O)C(Cl)=C1)O | | CAS DataBase Reference | 136496-72-5(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 20/21/22-36/37/38-41 | | Safety Statements | 26-36-39-37 | | WGK Germany | WGK 3 | | Hazard Note | Irritant/Keep Cold | | HazardClass | IRRITANT | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 4-Carboxy-3-chlorophenylboronic acid Usage And Synthesis |
| | 4-Carboxy-3-chlorophenylboronic acid Preparation Products And Raw materials |
|