| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
5-Carboxy-2-chlorobenzeneboronic acid 98 manufacturers
|
| | 5-Carboxy-2-chlorobenzeneboronic acid 98 Basic information |
| Product Name: | 5-Carboxy-2-chlorobenzeneboronic acid 98 | | Synonyms: | 3-BORONO-4-CHLOROBENZOIC ACID;5-CARBOXY-2-CHLOROBENZENEBORONIC ACID;5-CARBOXY-2-CHLOROPHENYLBORONIC ACID;2-CHLORO-5-CARBOXYPHENYLBORONIC ACID;5-Carboxy-2-Chlorophenylboroni;5-Carboxy-2-chlorobenzeneboronic acid 98%;REF DUPL: 5-Carboxy-2-chlorophenylboronic acid;4-chloro-3-(dihydroxyboranyl)benzoic acid | | CAS: | 913835-75-3 | | MF: | C7H6BClO4 | | MW: | 200.38 | | EINECS: | | | Product Categories: | blocks;BoronicAcids;Boronic Acid | | Mol File: | 913835-75-3.mol |  |
| | 5-Carboxy-2-chlorobenzeneboronic acid 98 Chemical Properties |
| Melting point | 228-244 | | Boiling point | 462.5±55.0 °C(Predicted) | | density | 1.55±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 3.98±0.10(Predicted) | | color | White to Almost white | | InChI | 1S/C7H6BClO4/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3,12-13H,(H,10,11) | | InChIKey | ZITWKFSVFMUWIE-UHFFFAOYSA-N | | SMILES | OB(C1=CC(C(O)=O)=CC=C1Cl)O | | CAS DataBase Reference | 913835-75-3 |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | WGK 3 | | Hazard Note | Irritant/Keep Cold | | HazardClass | IRRITANT, KEEP COLD | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1 |
| | 5-Carboxy-2-chlorobenzeneboronic acid 98 Usage And Synthesis |
| | 5-Carboxy-2-chlorobenzeneboronic acid 98 Preparation Products And Raw materials |
|
|
Tag:5-Carboxy-2-chlorobenzeneboronic acid 98(913835-75-3)
Related Product Information
|
|
Phenylboronic acid
3-Carboxy-4-chlorobenzeneboronic acid
4-Carboxy-2-chlorophenylboronic acid
5-Carboxy-2-chlorobenzeneboronic acid 98
4-Carboxy-3-chlorophenylboronic acid
2-Chloro-5-(ethoxycarbonyl)benzeneboronic acid 98
2-Chloro-5-(methoxycarbonyl)benzeneboronic acid 98
2-Chlorophenylboronic acid
5-Borono-4-chloro-2-methoxybenzoic acid
4-Chloro-3-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)benzoic acid
Methyl 5-borono-4-chloro-2-methoxybenzoate
5-Borono-4-chloro-2-fluorobenzoic acid
2-chloro-4-fluoro-5-methoxycarbonylphenylboronic acid
4-Chloro-3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzoic acid
Methyl 4-chloro-3-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)benzoate
Benzyl 4-chloro-3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzoate
Benzyl 4-chloro-3-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)benzoate
Methyl 4-chloro-3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzoate
|