| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
- Alloxazine
-
- $30.00
-
2026-05-11
- CAS:490-59-5
- Purity: 99.75%
- Supply Ability: 10g
|
| | Alloxazine Basic information |
| Product Name: | Alloxazine | | Synonyms: | Alloxazin;BENZO [G]PTERIDINE-2,4(1 H ,3 H)-DIONE;Benzo[g]pteridine-2,4(1H,3H)-dione, Isoalloxazine;Pyrimido[4,5-b]quinoxaline-2,4(1H,3H)-dione;cancer,Adenosine Receptor,Inhibitor,P1 receptor,inhibit,Isoalloxazine,Alloxazine,AMP,NECA;Alloxazine, 10 mM in DMSO;1,2,3,4-tetrahydrobenzopteridine-2,4-dione;1H,2H,3H,4H-benzo[g]pteridine-2,4-dione | | CAS: | 490-59-5 | | MF: | C10H6N4O2 | | MW: | 214.18 | | EINECS: | 207-714-3 | | Product Categories: | | | Mol File: | 490-59-5.mol |  |
| | Alloxazine Chemical Properties |
| storage temp. | Store at -20°C | | solubility | DMSO: 11 mg/mL | | density | 1.76±0.1 g/cm3(Predicted) | | Melting point | 410 °C (decomp) | | pKa | 10.00±0.50(Predicted) | | form | solid | | color | yellow | | InChI | 1S/C10H6N4O2/c15-9-7-8(13-10(16)14-9)12-6-4-2-1-3-5(6)11-7/h1-4H,(H2,12,13,14,15,16) | | InChIKey | HAUGRYOERYOXHX-UHFFFAOYSA-N | | SMILES | O=C1NC(=O)c2nc3ccccc3nc2N1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Alloxazine Usage And Synthesis |
| Uses | Alloxazine is used as a adenosine A2B receptor-sensitive renal vasodilation in female rats. | | Definition | A derivative of isoalloxazine, widely distributed in
plants and animals, usually as yellow pigments. |
| | Alloxazine Preparation Products And Raw materials |
|