- Lumichrome
-
- $66.00
-
2026-07-27
- CAS:1086-80-2
- Purity: 99.93%
- Supply Ability: 10g
- LUMICHROME
-
- $600.00
-
2024-04-12
- CAS:1086-80-2
- Min. Order: 1g
- Purity: 98
- Supply Ability: 500 Kg
|
| | LUMICHROME Basic information | | Uses |
| Product Name: | LUMICHROME | | Synonyms: | LUMICHROME;7,8-Dimethylbenzo[g]pteridine-2,4-diol;Benzo[g]pteridine-2,4(1H,3H)-dione, 7,8-dimethyl-;Lumichrome (I);Riboflavin lumichrome;7,8-dimethylbenzo[g]pteridine-2,4(1H,3H)-dione;7,8-Dimethylpyrimido[4,5-b]quinoxaline-2,4(3H,10H)-dione;7,8-Dimethylisoalloxazine | | CAS: | 1086-80-2 | | MF: | C12H10N4O2 | | MW: | 242.23 | | EINECS: | 214-120-8 | | Product Categories: | | | Mol File: | 1086-80-2.mol |  |
| | LUMICHROME Chemical Properties |
| Melting point | 300 °C | | Boiling point | 385.06°C (rough estimate) | | density | 1.2532 (rough estimate) | | refractive index | 1.6081 (estimate) | | storage temp. | Refrigerator | | solubility | Aqueous Base (Slightly), DMSO (Slightly, Heated, Sonicated) | | form | Solid | | pKa | 10.02±0.70(Predicted) | | color | Pale Yellow to Yellow | | λmax | 350 nm 392 nm (2nd) | | Merck | 13,5620 | | Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. | | Major Application | diagnostic assay manufacturing hematology histology | | InChI | 1S/C12H10N4O2/c1-5-3-7-8(4-6(5)2)14-10-9(13-7)11(17)16-12(18)15-10/h3-4H,1-2H3,(H2,14,15,16,17,18) | | InChIKey | ZJTJUVIJVLLGSP-UHFFFAOYSA-N | | SMILES | Cc1cc2nc3NC(=O)NC(=O)c3nc2cc1C | | CAS DataBase Reference | 1086-80-2(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 2933.99.8210 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ACROS
| English |
| | LUMICHROME Usage And Synthesis |
| Uses | Lumichrome is a derivative of Riboflavin, a vitamin with a key role in maintaining cellular function and health in human and animals. Dyes and metabolites. | | Chemical Properties | solid | | Uses | Lumichrome is a derivative of Riboflavin (R415000), a vitamin with a key role in maintaining cellular function and health in human and animals. Dyes and metabolites. | | Definition | ChEBI: A compound showing blue fluorescence, formed by a photolysis of riboflavin in acid or neutral solution. | | in vivo | Lumichrome (7.5 mg/kg, ip, three times a week for 6 weeks) reduces bone loss and prevents osteoporosis in the ovariectomized (OVX) mouse model[3]. | Animal Model: | OVX mouse model[3] | | Dosage: | 7.5 mg/kg | | Administration: | ip, three times a week for 6 weeks | | Result: | Increased bone mineral density (BMD) and bone volume fraction (BV/TV) in OVX mice, and reduced the osteoclast surface/bone surface (Oc.S/BS) ratio. |
| | Purification Methods | Recrystallise lumichrome twice from glacial AcOH and dry it at 100o in a vacuum. [Cresswell & Wood J Chem Soc 4768 1960, Beilstein 26 III/IV 2538.] |
| | LUMICHROME Preparation Products And Raw materials |
|