N-Phenyldiethanolamine 2-pyridylboronate manufacturers
|
| | N-Phenyldiethanolamine 2-pyridylboronate Basic information |
| | N-Phenyldiethanolamine 2-pyridylboronate Chemical Properties |
| Melting point | >300 °C (lit.) | | form | Powder | | color | White | | InChI | 1S/C15H17BN2O2/c1-2-6-14(7-3-1)18-10-12-19-16(20-13-11-18)15-8-4-5-9-17-15/h1-9H,10-13H2 | | InChIKey | QDIQDVHNUYDVDD-UHFFFAOYSA-N | | SMILES | B1(C2=CC=CC=N2)OCCN(C3=CC=CC=C3)CCO1 | | CAS DataBase Reference | 662138-96-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-67-41 | | Safety Statements | 26-36-39 | | RIDADR | UN 3175 4.1/PG 2 | | WGK Germany | 3 | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Eye Dam. 1 Flam. Sol. 1 Skin Sens. 1 |
| | N-Phenyldiethanolamine 2-pyridylboronate Usage And Synthesis |
| Chemical Properties | White to light yellow crystal powde | | Uses | Reactant involved in Suzuki-Miyaura cross-coupling reactions for synthesis of 2-pyridylboronate1 | | General Description | May contain varying amounts of isopropanol and N-phenyldiethanolamine as stabilizers |
| | N-Phenyldiethanolamine 2-pyridylboronate Preparation Products And Raw materials |
|