|
|
| | ANISOLE-2,4,6-D3 Basic information |
| | ANISOLE-2,4,6-D3 Chemical Properties |
| Melting point | -37 °C(lit.) | | Boiling point | 154 °C(lit.) | | density | 1.022 g/mL at 25 °C | | Fp | 125 °F | | InChI | 1S/C7H8O/c1-8-7-5-3-2-4-6-7/h2-6H,1H3/i2D,5D,6D | | InChIKey | RDOXTESZEPMUJZ-UJESMPABSA-N | | SMILES | [2H]c1cc([2H])c(OC)c([2H])c1 |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 16-26-36 | | RIDADR | UN 2222 3/PG 3 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 STOT SE 3 |
| | ANISOLE-2,4,6-D3 Usage And Synthesis |
| Uses | Anisole-2,4,6-d3 (CAS# 2567-25-1) is a useful isotopically labeled research compound. |
| | ANISOLE-2,4,6-D3 Preparation Products And Raw materials |
|