Verbenone manufacturers
- Verbenone
-
- $50.00
-
2025-05-23
- CAS:18309-32-5
- Min. Order: 1kg
- Purity: 99
- Supply Ability: 5000
|
| | Verbenone Basic information |
| Product Name: | Verbenone | | Synonyms: | (1r,5r)-(+)-2-pinen-4-on;(1R-cis)-4,6,6-Trimethylbicyclo(3.1.1)hept-3-en-2-one;(1R-cis)-4,6,6-Trimethylbicyclo(3.1.1)hept-3-ene-2-one;(R)-(+)-Verbenone;2-Pinen-4-one, (1R,5R)-(+)-;6,6-trimethyl-(1r)-bicyclo(3.1.1)hept-3-en-2-on;6,6-trimethyl-(1theta)-bicyclo[3.1.1]hept-3-en-2-on;Bicyclo[3.1.1]hept-3-en-2-one, 4,6,6-trimethyl-, (1R)- | | CAS: | 18309-32-5 | | MF: | C10H14O | | MW: | 150.22 | | EINECS: | 242-195-7 | | Product Categories: | | | Mol File: | 18309-32-5.mol |  |
| | Verbenone Chemical Properties |
| Melting point | 6.5° | | alpha | D18 +249.62° | | Boiling point | bp12 102-105°; bp760 227-228° | | density | d20 0.9780 | | refractive index | nD18 1.4957 | | storage temp. | Store at 0-8 °C | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Oil | | color | Colourless to Pale Yellow | | Cosmetics Ingredients Functions | PERFUMING | | InChI | InChI=1S/C10H14O/c1-6-4-9(11)8-5-7(6)10(8,2)3/h4,7-8H,5H2,1-3H3/t7-,8+/m1/s1 | | InChIKey | DCSCXTJOXBUFGB-SFYZADRCSA-N | | SMILES | [C@@]12([H])C[C@@]([H])(C1(C)C)C(C)=CC2=O | | LogP | 2.139 (est) | | EPA Substance Registry System | Bicyclo[3.1.1]hept-3-en-2-one, 4,6,6-trimethyl-, (1R,5R)- (18309-32-5) |
| | Verbenone Usage And Synthesis |
| Definition | ChEBI: (R)-(+)-verbenone is a 4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-one in which both chiral centres have R configuration. It is a component of Spanish verbena oil, from Verbena triphylla. It has a role as a plant metabolite. It is a terpenoid and a 4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-one. It is an enantiomer of a (S)-(-)-verbenone. |
| | Verbenone Preparation Products And Raw materials |
|