- 1,2-Diaminoanthraquinone
-
- $15.00 / 1KG
-
2021-07-02
- CAS:1758-68-5
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 1,2-DIAMINOANTHRAQUINONE Basic information |
| | 1,2-DIAMINOANTHRAQUINONE Chemical Properties |
| Melting point | 289-291 °C (lit.) | | Boiling point | 380.84°C (rough estimate) | | density | 1.1907 (rough estimate) | | refractive index | 1.6500 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 0.53±0.20(Predicted) | | form | Solid | | color | Brown to black | | BRN | 2125604 | | InChI | 1S/C14H10N2O2/c15-10-6-5-9-11(12(10)16)14(18)8-4-2-1-3-7(8)13(9)17/h1-6H,15-16H2 | | InChIKey | LRMDXTVKVHKWEK-UHFFFAOYSA-N | | SMILES | Nc1ccc2C(=O)c3ccccc3C(=O)c2c1N | | CAS DataBase Reference | 1758-68-5(CAS DataBase Reference) | | EPA Substance Registry System | 9,10-Anthracenedione, 1,2-diamino- (1758-68-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | RTECS | CB6200000 | | TSCA | TSCA listed | | HS Code | 2921599090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1,2-DIAMINOANTHRAQUINONE Usage And Synthesis |
| Uses | 1,2-Diaminoanthraquinone is for the direct detection of nitric oxide. |
| | 1,2-DIAMINOANTHRAQUINONE Preparation Products And Raw materials |
|