| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
(R)-(+)-Citronellic acid manufacturers
|
| | (R)-(+)-Citronellic acid Basic information |
| Product Name: | (R)-(+)-Citronellic acid | | Synonyms: | (R)-(+)-citronellic;3,7-DIMETHYL-6-OCTENOIC ACID;(R)-(+)-Citronellic acid 98%;6-Octenoic acid, 3,7-dimethyl-, (3R)-;(3R)-3,7-Dimethyl-6-octenoic acid;[R,(+)]-3,7-Dimethyl-6-octenoic acid;(3R)-3,7-DIMETHYLOCT-6-ENOIC ACID;(R)-(+)-Citronellic acid | | CAS: | 18951-85-4 | | MF: | C10H18O2 | | MW: | 170.25 | | EINECS: | | | Product Categories: | | | Mol File: | 18951-85-4.mol |  |
| | (R)-(+)-Citronellic acid Chemical Properties |
| Boiling point | 119 °C/3 mmHg (lit.) | | density | 0.926 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.4534(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Ether, Ethyl Acetate, Methanol (Slightly) | | pka | 4.78±0.10(Predicted) | | form | Oil | | color | Clear Pale Yellow to Pale Brown | | Optical Rotation | [α]25/D +8°, neat | | JECFA Number | 1221 | | Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. | | InChI | 1S/C10H18O2/c1-8(2)5-4-6-9(3)7-10(11)12/h5,9H,4,6-7H2,1-3H3,(H,11,12)/t9-/m1/s1 | | InChIKey | GJWSUKYXUMVMGX-SECBINFHSA-N | | SMILES | C[C@H](CC\C=C(/C)C)CC(O)=O |
| Hazard Codes | Xn | | Risk Statements | 21-38 | | Safety Statements | 26-36 | | RIDADR | UN 2810 6.1/PG 3 | | WGK Germany | 3 | | HS Code | 2916199590 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Dermal
Skin Irrit. 2 |
| | (R)-(+)-Citronellic acid Usage And Synthesis |
| Chemical Properties | colourless liquid | | Uses | (R)-(+)-Citronellic Acid is an oxidized derivative of Citronellal (C525025), a monoterpene compound that is formed by the metabolism of plants. | | Definition | ChEBI: (R)-citronellic acid is a citronellic acid that has (R)-configuration. It is an enantiomer of a (S)-citronellic acid. |
| | (R)-(+)-Citronellic acid Preparation Products And Raw materials |
|