| Company Name: |
SHANG FLUORO Gold |
| Tel: |
021-65170832 15601903708 |
| Email: |
qinba_1@163.com |
2,2-Difluoroethyl p-toluenesulfonate manufacturers
|
| | 2,2-Difluoroethyl p-toluenesulfonate Basic information |
| Product Name: | 2,2-Difluoroethyl p-toluenesulfonate | | Synonyms: | 2,2-Difluoroethyl (4-methylphenyl)sulphonate;2,2-DIFLUOROETHYL TOSYLATE;2,2-DIFLUOROETHYL-4-TOLUENESULPHONATE;2,2-Difluoroethyltoluene-4-sulphonate97%;2,2-Difluoroethyl (4-methylphenyl)sulphonate 97%;2,2-Difluoroethyl(4-methylphenyl)sulphonate97%;2,2-Difluoroethyl toluene-4-sulphonate 97%;2,2-Difluoroethyl tosylate, 2,2-Difluoroethyl 4-methylbenzenesulphonate | | CAS: | 135206-84-7 | | MF: | C9H10F2O3S | | MW: | 236.24 | | EINECS: | | | Product Categories: | | | Mol File: | 135206-84-7.mol |  |
| | 2,2-Difluoroethyl p-toluenesulfonate Chemical Properties |
| Boiling point | 335.0±32.0 °C(Predicted) | | density | 1.300±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | liquid | | color | Clear | | InChI | InChI=1S/C9H10F2O3S/c1-7-2-4-8(5-3-7)15(12,13)14-6-9(10)11/h2-5,9H,6H2,1H3 | | InChIKey | ZUBSOOAAXYCXMN-UHFFFAOYSA-N | | SMILES | C(OS(C1=CC=C(C)C=C1)(=O)=O)C(F)F |
| Hazard Codes | Xi | | Risk Statements | 10-20/21-38 | | Safety Statements | 25 | | RIDADR | UN 1307 3 / PGIII | | HazardClass | IRRITANT | | HS Code | 2904100090 |
| | 2,2-Difluoroethyl p-toluenesulfonate Usage And Synthesis |
| Uses | 2,2-Difluoroethyl P-Toluenesulfonate is a reagent used in the preparation of (difluorophenyl)[(arylmethyl)thio](triazolyl)butanol fungicides. |
| | 2,2-Difluoroethyl p-toluenesulfonate Preparation Products And Raw materials |
|