|
|
| | 1-METHYL-4-(4-NITROPHENYL)PIPERAZINE Basic information |
| Product Name: | 1-METHYL-4-(4-NITROPHENYL)PIPERAZINE | | Synonyms: | 1-METHYL-4-(4-NITROPHENYL)PIPERAZINE;1-Methyl-4-(4-nitrophenyl)piperazine95%;1-METHYL-4-(4-NITROPHENYL)PIPERAZINE 95%;Piperazine, 1-Methyl-4-(4-nitrophenyl)-;1-Methyl-4-(4-nitrophenyl)piperizine;1-METHYL-4-(4-NITROPHENYL)PIPERAZIN-1-IUM;1-Methyl-4-(4-nitrophenyl)piperazine,97%;1-METHYL-4-(4-NITROPHENYL)PIPERAZINE ISO 9001:2015 REACH | | CAS: | 16155-03-6 | | MF: | C11H15N3O2 | | MW: | 221.26 | | EINECS: | | | Product Categories: | | | Mol File: | 16155-03-6.mol |  |
| | 1-METHYL-4-(4-NITROPHENYL)PIPERAZINE Chemical Properties |
| Melting point | 109-111°C | | Boiling point | 369.5±37.0 °C(Predicted) | | density | 1.198±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 7.41±0.42(Predicted) | | form | Solid | | Appearance | Orange to red Solid | | InChI | InChI=1S/C11H15N3O2/c1-12-6-8-13(9-7-12)10-2-4-11(5-3-10)14(15)16/h2-5H,6-9H2,1H3 | | InChIKey | GZNDUKANJZIZOT-UHFFFAOYSA-N | | SMILES | N1(C)CCN(C2=CC=C([N+]([O-])=O)C=C2)CC1 |
| | 1-METHYL-4-(4-NITROPHENYL)PIPERAZINE Usage And Synthesis |
| Chemical Properties | Red solid | | Uses | 1-methyl-4-(4-nitrophenyl)piperazine was a reagent in the preparation of diaminopyrimidines as reversible and irreversible inhibitors of mutant EGFR tyrosine kinases for treatment of non-small-cell lung cancer. It was also used in the prepn. of disubstituted pyrimidine compds. as EGFR or/and ALK inhibitors useful in the treatment of diseases. |
| | 1-METHYL-4-(4-NITROPHENYL)PIPERAZINE Preparation Products And Raw materials |
|