| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Fmoc-Gln(Tmob)-OH Basic information |
| Product Name: | Fmoc-Gln(Tmob)-OH | | Synonyms: | N(alpha)-fmoc-N(delta)-(2,4,6-trimetho-xybenzyl)-L-glutamin;FMOC-N-DELTA-2,4,6-TRIMETHOXYBENZYL-L-GLUTAMINE;FMOC-GLUTAMINE(TMOB)-OH;N-ALPHA-FMOC-N-DELTA-(2,4,6-TRIMETHOXYBENZYL)-L-GLUTAMINE;N-ALPHA-(9-FLUORENYLMETHOXYCARBONYL)-N-GAMMA-TRIMETHOXYBENZYL-L-GLUTAMINE;(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-[(2,4,6-trimethoxyphenyl)methylamino]pentanoic acid;Fmoc-L-Gln(Tmob)-OH;Nα-Fmoc-Nδ-2,4,6-trimethoxybenzyl-L-glutamine99% | | CAS: | 120658-64-2 | | MF: | C30H32N2O8 | | MW: | 548.58 | | EINECS: | | | Product Categories: | | | Mol File: | 120658-64-2.mol |  |
| | Fmoc-Gln(Tmob)-OH Chemical Properties |
| Boiling point | 827.167±65.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.273±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | 2-8°C | | pka | 3.731±0.10(predicted) | | Major Application | peptide synthesis | | InChIKey | ORRRSRMARPWARV-VWLOTQADSA-N | | SMILES | COc1cc(OC)c(CNC(=O)CC[C@H](NC(=O)OCC2c3ccccc3-c4ccccc24)C(O)=O)c(OC)c1 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-Gln(Tmob)-OH Usage And Synthesis |
| Uses | Fmoc-gln(tmob)-oh acts as a reagent in peptide synthesis. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-Gln(Tmob)-OH Preparation Products And Raw materials |
|