|
|
| | 2,4-Dimethoxybenzylamine Basic information |
| | 2,4-Dimethoxybenzylamine Chemical Properties |
| Boiling point | 95 °C0.2 mm Hg(lit.) | | density | 1.113 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.549(lit.) | | Fp | >230 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | Liquid | | pka | 9.39±0.10(Predicted) | | color | Clear colorless to slightly yellow | | Sensitive | Air Sensitive | | InChI | InChI=1S/C9H13NO2/c1-11-8-4-3-7(6-10)9(5-8)12-2/h3-5H,6,10H2,1-2H3 | | InChIKey | QOWBXWFYRXSBAS-UHFFFAOYSA-N | | SMILES | C1(CN)=CC=C(OC)C=C1OC | | CAS DataBase Reference | 20781-20-8(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 2735 8/PG 3 | | WGK Germany | 3 | | RTECS | DP4430000 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29222990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | 2,4-Dimethoxybenzylamine Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liqui | | Uses | 2,4-Dimethoxybenzylamine is an amine nucleophile used to investigate the 1,4- reactivity of 5-bromo-2-indene-1-one. It may be used in the following studies:
- As an ammonia equivalent in the concise synthesis of a series of 2,4,5-trisubstituted oxazoles, via a tandem Ugi/Robinson-Gabriel reaction sequence.
- Total synthesis of (-)-muraymycin (MRY) D2 and its epimer, the antibacterial nucleoside natural product.
- Two-step synthesis of amide derivatives of uracil polyoxin C (UPOC) methyl ester using the Ugi reaction.
- Synthesis of N-hydroxythiourea.
- Synthesis of anti-HIV-1 agents.
| | General Description | 2,4-Dimethoxybenzylamine can be preprepared by reduction (NaBH4 , BF3.OEt2, THF) of 2,4-dimethoxybenzonitrile. |
| | 2,4-Dimethoxybenzylamine Preparation Products And Raw materials |
|