|
|
| | Boc-D-Arg(Mts)-OH cha Basic information |
| Product Name: | Boc-D-Arg(Mts)-OH cha | | Synonyms: | N-alpha-Boc-Nomega-(mesitylene-2-sulfonyl)-D-arginine cyclohexylammonium salt;N-ALPHA-BOC-N-OMEGA-(MESITYLENE-2-SULFONYL)-L-ARGININE CYCLOHEXYLAMINE SALT;BOC-D-ARGININE(MTS)-OH CHA;BOC-N-OMEGA-(MESITYLENE-2-SULFONYL)-D-ARGININE CYCLOHEXYLAMMONIUM SALT;Boc-Arg(Mts)-OH cyclohexylamine salt;N(alpha)-boc-N(omega)-(mesitylene-2-sul-fonyl)-L-arg. cycloh;nα-boc-nω-(mesitylene-2-sulfonyl)-l-arginine cyclohexylamine salt;Boc-Arg(Mts)-OH cyclohexylammonium salt | | CAS: | 68262-72-6 | | MF: | C26H45N5O6S | | MW: | 555.73 | | EINECS: | | | Product Categories: | | | Mol File: | 68262-72-6.mol |  |
| | Boc-D-Arg(Mts)-OH cha Chemical Properties |
| Melting point | ~130 °C | | storage temp. | -15°C | | form | solid | | Optical Rotation | [α]20/D +11.5±1°, c = 0.5% in methanol | | Major Application | peptide synthesis | | InChIKey | YZLIRHMRDOFTHQ-XFULWGLBSA-N | | SMILES | NC1CCCCC1.Cc2cc(C)c(c(C)c2)S(=O)(=O)NC(=N)NCCC[C@@H](NC(=O)OC(C)(C)C)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Boc-D-Arg(Mts)-OH cha Usage And Synthesis |
| Chemical Properties | White powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-D-Arg(Mts)-OH cha Preparation Products And Raw materials |
|