|
|
| | METHYL 2-BROMO-4-NITROBENZOATE Basic information |
| Product Name: | METHYL 2-BROMO-4-NITROBENZOATE | | Synonyms: | methy 2-bromo-4-nitrobenzoate;2-BroMo-4-nitrobenzoic acid Methyl ester;3-Bromo-4-(methoxycarbonyl)nitrobenzene;4-nitro-2-broMobenzoic acid Methyl ester;Methyl 2-bromo-4-nitrobenzoate 97%;METHYL 2-BROMO-4-NITROBENZOATE;2-Bromo-4-nitro-benzoic acid methyleste;Methyl2-Bromo-4-nitrobenzoate> | | CAS: | 100959-22-6 | | MF: | C8H6BrNO4 | | MW: | 260.04 | | EINECS: | | | Product Categories: | blocks;Bromides;Carboxes;NitroCompounds | | Mol File: | 100959-22-6.mol |  |
| | METHYL 2-BROMO-4-NITROBENZOATE Chemical Properties |
| Melting point | 82.0 to 86.0 °C | | Boiling point | 339.2±27.0 °C(Predicted) | | density | 1.673±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | Light orange to Yellow to Green | | InChI | InChI=1S/C8H6BrNO4/c1-14-8(11)6-3-2-5(10(12)13)4-7(6)9/h2-4H,1H3 | | InChIKey | XYMZAFDNPJLOTP-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=C([N+]([O-])=O)C=C1Br | | CAS DataBase Reference | 100959-22-6(CAS DataBase Reference) |
| | METHYL 2-BROMO-4-NITROBENZOATE Usage And Synthesis |
| Synthesis | Example 54B Synthesis of methyl 2-bromo-4-nitrobenzoate: 2-bromo-4-nitrobenzoic acid (1.0 g, 4.06 mmol) and potassium carbonate (560 mg) were dissolved in N,N-dimethylformamide (5 mL), followed by the addition of iodomethane (500 μL, 8.03 mmol). The reaction mixture was stirred at room temperature for 1 hour. After completion of the reaction, the mixture was poured into water (30 mL) and extracted with ether (3 x 10 mL). The combined ether layers were washed sequentially with water (1 × 10 mL) and brine (1 × 10 mL), dried over anhydrous magnesium sulfate, filtered, and concentrated under reduced pressure to afford the target product methyl 2-bromo-4-nitrobenzoate (970 mg, 92% yield). The product was confirmed by 1H NMR (300 MHz, CDCl3): δ 8.52 (d, 1H, J=2.4 Hz), 8.21 (dd, 1H, J=2.0,8.5 Hz), 7.92 (d, 1H, J=8.8 Hz), 3.99 (s, 3H); the mass spectrum (ESI) showed m/z=259 (M-H). | | References | [1] Patent: WO2013/148365, 2013, A1. Location in patent: Paragraph 00101
[2] Patent: US2002/35137, 2002, A1
[3] Bioorganic and Medicinal Chemistry, 2008, vol. 16, # 4, p. 1702 - 1720 |
| | METHYL 2-BROMO-4-NITROBENZOATE Preparation Products And Raw materials |
|