| Company Name: |
Wuhan Yanzhe Technology Co., Ltd Gold
|
| Tel: |
15527250409 |
| Email: |
wenhaotian12@163.com |
| Products Intro: |
Product Name:Levosimendan Impurity 14 (Dextrosimendan)
CAS:144238-75-5
Purity:98% HPLC Package:10mg；25mg；50mg；100mg
|
|
| | Levosimendan Impurity 14 Basic information |
| Product Name: | Levosimendan Impurity 14 | | Synonyms: | Levosimendan Impurity 14;Levosimendan Impurity 14 (Dextrosimendan);Right West Mendan;Dextrosimendan;(S)-Levosimendan;(S)-N-(4-(4-methyl-6-oxo-1,4,5,6-tetrahydro-pyridazin-3-yl)phenyl)carbonohydrazonoyl dicyanide;(S)-LevosimendanQ: What is
(S)-Levosimendan Q: What is the CAS Number of
(S)-Levosimendan Q: What is the storage condition of
(S)-Levosimendan;Propanedinitrile, 2-[2-[4-[(4S)-1,4,5,6-tetrahydro-4-methyl-6-oxo-3-pyridazinyl]phenyl]hydrazinylidene]- | | CAS: | 144238-75-5 | | MF: | C14H12N6O | | MW: | 280.28 | | EINECS: | | | Product Categories: | | | Mol File: | 144238-75-5.mol |  |
| | Levosimendan Impurity 14 Chemical Properties |
| Melting point | >120°C (dec.) | | density | 1.33±0.1 g/cm3(Predicted) | | storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 6.12±0.10(Predicted) | | color | Yellow to Dark Yellow | | InChI | InChI=1S/C14H12N6O/c1-9-6-13(21)19-20-14(9)10-2-4-11(5-3-10)17-18-12(7-15)8-16/h2-5,9,17H,6H2,1H3,(H,19,21)/t9-/m0/s1 | | InChIKey | WHXMKTBCFHIYNQ-VIFPVBQESA-N | | SMILES | C(#N)/C(=N/NC1=CC=C(C2=NNC(=O)C[C@@H]2C)C=C1)/C#N |
| | Levosimendan Impurity 14 Usage And Synthesis |
| Uses | Dextrosimendan is an isomer and impurity of Levosimendan (L378000), a bioactive enantiomer of Simendan (S466000). Levosimendan is a positive inotropic agent with vasodilating activity. |
| | Levosimendan Impurity 14 Preparation Products And Raw materials |
|