|
|
| | (S)-3(2h)-Pyridazinone, 6-(4-Aminophenyl)-4,5-Dihydro-5-Methyl- Basic information |
| Product Name: | (S)-3(2h)-Pyridazinone, 6-(4-Aminophenyl)-4,5-Dihydro-5-Methyl- | | Synonyms: | (S)-3(2h)-Pyridazinone, 6-(4-Aminophenyl)-4,5-Dihydro-5-Methyl-;3(2H)-Pyridazinone, 6-(4-aMinophenyl)-4,5-dihydro-5-Methyl-, (5S)-;(S)-6-(4-aMinophenyl)-5-Methyl-4,5-dihydropyridazin-3(2H)-one;Levosimendan Impurity 17;(5S)-6-(4-Aminophenyl)-4,5-dihydro-5-methyl-3(2H)-pyridazinone;Levosimendan isomer | | CAS: | 101328-84-1 | | MF: | C11H13N3O | | MW: | 203.24 | | EINECS: | | | Product Categories: | | | Mol File: | 101328-84-1.mol |  |
| | (S)-3(2h)-Pyridazinone, 6-(4-Aminophenyl)-4,5-Dihydro-5-Methyl- Chemical Properties |
| InChI | InChI=1S/C11H13N3O/c1-7-6-10(15)13-14-11(7)8-2-4-9(12)5-3-8/h2-5,7H,6,12H2,1H3,(H,13,15)/t7-/m0/s1 | | InChIKey | GDMRFHZLKNYRRO-ZETCQYMHSA-N | | SMILES | C1(=O)NN=C(C2=CC=C(N)C=C2)[C@@H](C)C1 |
| | (S)-3(2h)-Pyridazinone, 6-(4-Aminophenyl)-4,5-Dihydro-5-Methyl- Usage And Synthesis |
| Uses | (5S)-6-(4-Aminophenyl)-4,5-dihydro-5-methyl-3(2H)-pyridazinone is an intermediate in the synthesis of Dextrosimendan (D299550), an isomer and impurity of Levosimendan (L378000), a bioactive enantiomer of Simendan (S466000). Levosimendan is a positive inotropic agent with vasodilating activity. |
| | (S)-3(2h)-Pyridazinone, 6-(4-Aminophenyl)-4,5-Dihydro-5-Methyl- Preparation Products And Raw materials |
|