- Diphenyl isophthalate
-
- $1.00 / 1kg
-
2019-07-06
- CAS:744-45-6
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100KG
|
| | Diphenyl isophthalate Basic information |
| | Diphenyl isophthalate Chemical Properties |
| Melting point | 136-138 °C (lit.) | | Boiling point | 275 °C (10 mmHg) | | density | 1,2 g/cm3 | | refractive index | 1.5400 (estimate) | | Fp | 223 °C | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Almost white | | Water Solubility | insoluble | | InChI | 1S/C20H14O4/c21-19(23-17-10-3-1-4-11-17)15-8-7-9-16(14-15)20(22)24-18-12-5-2-6-13-18/h1-14H | | InChIKey | FHESUNXRPBHDQM-UHFFFAOYSA-N | | SMILES | O=C(Oc1ccccc1)c2cccc(c2)C(=O)Oc3ccccc3 | | CAS DataBase Reference | 744-45-6(CAS DataBase Reference) | | NIST Chemistry Reference | Diphenyl isophthalate(744-45-6) | | EPA Substance Registry System | Diphenyl isophthalate (744-45-6) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29173990 | | Storage Class | 11 - Combustible Solids |
| | Diphenyl isophthalate Usage And Synthesis |
| Chemical Properties | white to off-white powder | | Uses | Diphenyl isophthalate may be employed for the preparation of:
- poly(benzoxazole) (PBO) precursor, poly(o-hydroxyamide)
- 3[4″-hydroxybenzoyl)-4′-hydroxybenzophenone
- poly(o-hydroxyamide), via polycondensation of 2,2-bis(3-amino-4-hydroxyphenyl)hexafluoropropane in 1-methyl-2-pyrrolidinone
|
| | Diphenyl isophthalate Preparation Products And Raw materials |
|