|
|
| | Sorafenib N-oxide Basic information |
| Product Name: | Sorafenib N-oxide | | Synonyms: | Sorafenib impurity 23/Sorafenib N-Oxide/4-(4-(3-(4-chloro-3-(trifluoromethyl)phenyl)ureido)phenoxy)-2-(methylcarbamoyl)pyridine 1-oxide;4-[4-[[[[4-Chloro-3-(trifluoroMethyl)phenyl]aMino]carbonyl]aMino]phenoxy]-N-Methyl-2-pyridinecarboxaMide 1-Oxide;Sorafenib Impurity 27(Sorafenib N-Oxide);2-Pyridinecarboxamide, 4-[4-[[[[4-chloro-3-(trifluoromethyl)phenyl]amino]carbonyl]amino]phenoxy]-N-methyl-, 1-oxide;4-(4-(3-(4-chloro-3-(trifluoromethyl)phenyl)ureido)phenoxy)-2-(methylcarbamoyl)pyridine 1-oxide;Sorafenib impurities172;Sorafenib impurities11;Sorafenib N-oxide | | CAS: | 583840-03-3 | | MF: | C21H16ClF3N4O4 | | MW: | 480.82 | | EINECS: | | | Product Categories: | Metabolites;Various Metabolites and Impurities | | Mol File: | 583840-03-3.mol |  |
| | Sorafenib N-oxide Chemical Properties |
| Melting point | 220-222oC | | Boiling point | 591.7±50.0 °C(Predicted) | | density | 1.45±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | DMSO: soluble; Methanol: very slightly soluble, heated | | form | A solid | | pka | 12.89±0.70(Predicted) | | color | white to off-white | | biological source | synthetic | | Major Application | clinical research
general analytical
life science and biopharma
metabolomics | | InChI | 1S/C21H16ClF3N4O4/c1-26-19(30)18-11-15(8-9-29(18)32)33-14-5-2-12(3-6-14)27-20(31)28-13-4-7-17(22)16(10-13)21(23,24)25/h2-11H,1H3,(H,26,30)(H2,27,28,31) | | InChIKey | BQAZCCVUZDIZDC-UHFFFAOYSA-N | | SMILES | CNC(=O)C1=[N+](C=CC(=C1)OC2=CC=C(C=C2)NC(=O)NC3=CC(=C(C=C3)Cl)C(F)(F)F)[O-] |
| WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids |
| | Sorafenib N-oxide Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | A metabolite of Sorafenib, a potent Raf kinase inhibitor. |
| | Sorafenib N-oxide Preparation Products And Raw materials |
|