| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (R)-Boc-4-(trifluoromethyl)-beta-Phe-OH Basic information |
| Product Name: | (R)-Boc-4-(trifluoromethyl)-beta-Phe-OH | | Synonyms: | (3R)-3-{[(tert-butoxy)carbonyl]amino}-3-[4-(trifluoromethyl)phenyl]propanoic acid;Boc-4-(trifluoromethyl)-L-β-phenylalanine, (R)-3-(Boc-amino)-3-[4-(trifluoromethyl)phenyl]propionic acid;Boc-4-TrifluoroMethyl-D-b-phenylalanine;(R)-3-((tert-Butoxycarbonyl)amino)-3-(4-(trifluoromethyl)phenyl)propanoic acid;(r)-boc-4-(trifluoromethyl)-β-phe-oh;Boc-D-b-Phe(4-CF3)-OH;(Tert-Butoxy)Carbonyl (R)-3-Amino-3-(4-trifluoromethyl-phenyl)propionic acid;Boc-D-3-Amino-3-(4-trifluoromethylphenyl)propanoic acid | | CAS: | 501015-19-6 | | MF: | C15H18F3NO4 | | MW: | 333.3 | | EINECS: | | | Product Categories: | | | Mol File: | 501015-19-6.mol |  |
| | (R)-Boc-4-(trifluoromethyl)-beta-Phe-OH Chemical Properties |
| Boiling point | 432.7±45.0 °C(Predicted) | | density | 1.269±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder | | pka | 4.21±0.10(Predicted) | | Appearance | White to off-white Solid | | Major Application | peptide synthesis | | InChI | 1S/C15H18F3NO4/c1-14(2,3)23-13(22)19-11(8-12(20)21)9-4-6-10(7-5-9)15(16,17)18/h4-7,11H,8H2,1-3H3,(H,19,22)(H,20,21)/t11-/m1/s1 | | InChIKey | WJMVMQYNFZQHGW-LLVKDONJSA-N | | SMILES | CC(C)(C)OC(=O)N[C@H](CC(O)=O)c1ccc(cc1)C(F)(F)F |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (R)-Boc-4-(trifluoromethyl)-beta-Phe-OH Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | (R)-Boc-4-(trifluoromethyl)-beta-Phe-OH Preparation Products And Raw materials |
|