|
|
| | 3-Amino-3-(4-trifluoromethyl-phenyl)-propionic acid Basic information |
| Product Name: | 3-Amino-3-(4-trifluoromethyl-phenyl)-propionic acid | | Synonyms: | DL-3-AMINO-3-(4-TRIFLUOROMETHYL-PHENYL)-PROPIONIC ACID;DL-BETA-(P-TRIFLUOROMETHYLPHENYL)ALANINE;3-AMINO-3-[4-(TRIFLUOROMETHYL)PHENYL]PROPANOIC ACID;RARECHEM AK HW 0019;3-(P-TRIFLUOROMETHYLPHENYL)-DL-BETA-ALANINE;DL-3-AMINO-3-(4-TRIFLUOROMETHYL-PHENYL)-PHENYLPROPIONIC ACID;DL-beta-(4-Trifluoromethylphenyl)alanine;4-TrifluoroMethyl-DL-b-phenylalanine | | CAS: | 180263-44-9 | | MF: | C10H10F3NO2 | | MW: | 233.19 | | EINECS: | | | Product Categories: | B-Amino | | Mol File: | 180263-44-9.mol |  |
| | 3-Amino-3-(4-trifluoromethyl-phenyl)-propionic acid Chemical Properties |
| Boiling point | 317.0±42.0 °C(Predicted) | | density | 1.361±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | form | solid | | pka | 3.56±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | 1S/C10H10F3NO2/c11-10(12,13)7-3-1-6(2-4-7)8(14)5-9(15)16/h1-4,8H,5,14H2,(H,15,16) | | InChIKey | ABDRZHVLIRZFQO-UHFFFAOYSA-N | | SMILES | O=C(O)CC(N)C1=CC=C(C=C1)C(F)(F)F | | CAS DataBase Reference | 180263-44-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | HS Code | 2922498590 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 3-Amino-3-(4-trifluoromethyl-phenyl)-propionic acid Usage And Synthesis |
| | 3-Amino-3-(4-trifluoromethyl-phenyl)-propionic acid Preparation Products And Raw materials |
|