5'-O-(4,4'-DIMETHOXYTRITYL)ADENOSINE manufacturers
|
| | 5'-O-(4,4'-DIMETHOXYTRITYL)ADENOSINE Basic information |
| Product Name: | 5'-O-(4,4'-DIMETHOXYTRITYL)ADENOSINE | | Synonyms: | 5'-DMT-rA;5'-O-DMT-adenosine;Adenosine, 5'-O-[bis(4-Methoxyphenyl)phenylMethyl]-;5'-O-[Bis(4-methoxyphenyl)phenylmethyl]-adenosine;5'-O-dimethoxytrityladenosine;(2R,3R,4S,5R)-2-(6-amino-9H-purin-9-yl)-5-((bis(4-methoxyphenyl)(phenyl)methoxy)methyl)tetrahydrofuran-3,4-diol;5'-O-(4,4'-Dimethoxytrityl)adenosine;5'-O-(4,4'-DIMETHOXYTRITYL)ADENOSINE | | CAS: | 81352-25-2 | | MF: | C31H31N5O6 | | MW: | 569.61 | | EINECS: | | | Product Categories: | | | Mol File: | 81352-25-2.mol |  |
| | 5'-O-(4,4'-DIMETHOXYTRITYL)ADENOSINE Chemical Properties |
| Melting point | 145-147 °C | | Boiling point | 812.0±75.0 °C(Predicted) | | density | 1.40±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | form | Solid | | pka | 13.08±0.70(Predicted) | | color | White to off-white | | InChIKey | KOQFCLKBHJBRTB-WMPYGVGNNA-N | | SMILES | O(C(C1=CC=C(OC)C=C1)(C1=CC=C(OC)C=C1)C1=CC=CC=C1)C[C@H]1O[C@@H](N2C3=C(C(=NC=N3)N)N=C2)[C@H](O)[C@@H]1O |&1:25,27,38,40,r| |
| | 5'-O-(4,4'-DIMETHOXYTRITYL)ADENOSINE Usage And Synthesis |
| Uses | 5''-O-[Bis(4-methoxyphenyl)phenylmethyl]-adenosine is an oligonucleotide used in the synthesis of oligonucleotides carrying fluorescently labeled O6-alkylguanine for measuring hAGT activity. |
| | 5'-O-(4,4'-DIMETHOXYTRITYL)ADENOSINE Preparation Products And Raw materials |
|