| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (R)-(-)-1-Benzyloxy-2-propanol Basic information |
| Product Name: | (R)-(-)-1-Benzyloxy-2-propanol | | Synonyms: | (R)-(-)-1-BENZYLOXY-2-PROPANOL 97;(2R)-1-(PhenylMethoxy)-2-propanol;2-Propanol,1-(phenylMethoxy)-, (2R)-;(2R)-1-Benzyloxypropan-2-ol;(R)-(-)-1-Benzyloxy-2-propanol 97%;(2R)-1-phenylmethoxypropan-2-ol;(R)?-1-?(Phenylmethoxy)?-2-?propanol;(R)-(?)-1-Benzyloxy-2-propanol | | CAS: | 89401-28-5 | | MF: | C10H14O2 | | MW: | 166.22 | | EINECS: | | | Product Categories: | | | Mol File: | 89401-28-5.mol |  |
| | (R)-(-)-1-Benzyloxy-2-propanol Chemical Properties |
| Boiling point | 263.8±15.0 °C(Predicted) | | density | 1.027 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.510(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | solubility | Chloroform, Ethyl Acetate (Slightly) | | form | Oil | | pka | 14.46±0.20(Predicted) | | color | Colourless | | Optical Rotation | [α]20/D -14°, c = 1 in chloroform | | InChI | InChI=1S/C10H14O2/c1-9(11)7-12-8-10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3/t9-/m1/s1 | | InChIKey | KJBPYIUAQLPHJG-SECBINFHSA-N | | SMILES | C(OCC1=CC=CC=C1)[C@H](O)C |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2909498090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (R)-(-)-1-Benzyloxy-2-propanol Usage And Synthesis |
| Uses | (R)-(-)-1-Benzyloxy-2-propanol is the R-isomer of 1-Benzyloxy-2-propanol (B287760), a compound used in the synthetic preparation of glucokinase activators for the treatment of diabetes. |
| | (R)-(-)-1-Benzyloxy-2-propanol Preparation Products And Raw materials |
|