| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2 3 4 5 6-PENTAFLUOROBENZYLZINC BROMIDE& Basic information |
| Product Name: | 2 3 4 5 6-PENTAFLUOROBENZYLZINC BROMIDE& | | Synonyms: | 2,3,4,5,6-PENTAFLUOROBENZYLZINC BROMIDE 0.5M SOLUTION IN TETRAHYDROFURAN;2,3,4,5,6-pentafluorobenzylzinc bromide solution;2,3,4,5,6-Pentafluorobenzylzinc bromide solution 0.5 in THF;2,3,4,5,6-Pentafluorobenzylzinc bromide solution 0.5M in THF | | CAS: | 352534-75-9 | | MF: | C7H2BrF5Zn | | MW: | 326.37 | | EINECS: | | | Product Categories: | Alkyl;Organozinc Halides;Reike and Organozinc Reagents | | Mol File: | 352534-75-9.mol |  |
| | 2 3 4 5 6-PENTAFLUOROBENZYLZINC BROMIDE& Chemical Properties |
| Boiling point | 65 °C | | density | 1.018 g/mL at 25 °C | | Fp | 1 °F | | storage temp. | 2-8°C | | InChI | 1S/C7H2F5.BrH.Zn/c1-2-3(8)5(10)7(12)6(11)4(2)9;;/h1H2;1H;/q;;+1/p-1 | | InChIKey | WAKJCJJTVRCONB-UHFFFAOYSA-M | | SMILES | Fc1c(F)c(F)c(C[Zn]Br)c(F)c1F |
| Hazard Codes | Xi,Xn,F | | Risk Statements | 36/37-40-19-11 | | Safety Statements | 16-26-36/37 | | RIDADR | UN 2056 3/PG 2 | | WGK Germany | 1 | | HS Code | 2827590000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Flam. Liq. 2 STOT SE 3 |
| | 2 3 4 5 6-PENTAFLUOROBENZYLZINC BROMIDE& Usage And Synthesis |
| | 2 3 4 5 6-PENTAFLUOROBENZYLZINC BROMIDE& Preparation Products And Raw materials |
|