| Company Name: |
Shijiazhuang Sdyano Fine Chemical Co., Ltd.
|
| Tel: |
0311-89250318 031166536426 |
| Email: |
master@sjzsdyn.com |
| Products Intro: |
Product Name:4-PENTYLPHENYL 4-OCTYLOXYBENZOATE, 97 CAS:50649-56-4 Purity:98% Package:10G;1KG
|
| Company Name: |
Bide Pharmatech Ltd.
|
| Tel: |
400-400-164-7117 18317119277 |
| Email: |
product02@bidepharm.com |
| Products Intro: |
Product Name:4-Pentylphenyl 4-(octyloxy)benzoate CAS:50649-56-4 Purity:97% Package:1g;5g;25g Remarks:BD00946650
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:4-Pentylphenyl 4-(octyloxy)benzoate CAS:50649-56-4 Purity:97% Package:5G Remarks:665711-5G
|
|
| | 4-PENTYLPHENYL 4-OCTYLOXYBENZOATE, 97 Basic information |
| | 4-PENTYLPHENYL 4-OCTYLOXYBENZOATE, 97 Chemical Properties |
| Melting point | 53-57 °C | | Boiling point | 515.5±43.0 °C(Predicted) | | density | 1.004±0.06 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | -20°C | | form | liquid crystal | | Appearance | White to off-white Solid | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChI | 1S/C26H36O3/c1-3-5-7-8-9-11-21-28-24-19-15-23(16-20-24)26(27)29-25-17-13-22(14-18-25)12-10-6-4-2/h13-20H,3-12,21H2,1-2H3 | | InChIKey | BDTRDPSFINNZRW-UHFFFAOYSA-N | | SMILES | CCCCCCCCOc1ccc(cc1)C(=O)Oc2ccc(CCCCC)cc2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 |
| | 4-PENTYLPHENYL 4-OCTYLOXYBENZOATE, 97 Usage And Synthesis |
| | 4-PENTYLPHENYL 4-OCTYLOXYBENZOATE, 97 Preparation Products And Raw materials |
|