| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-Amylphenyl 4'-methoyxbenzoate Basic information |
| Product Name: | 4-Amylphenyl 4'-methoyxbenzoate | | Synonyms: | NEMATAL 105;4-METHOXYBENZOIC ACID-4'-(N-PENTYL)PHENYL ESTER;4-N-PENTYLPHENYL P-ANISATE;p-pentylphenyl p-anisate;4-METHOXYBENZOIC ACID-4'-(N-PENTYL)PHENOL ESTER;4-n-Pentylphenyl p-anisate, 4-Amylphenyl 4μ-methoyxbenzoate, Nematal 105;4-Methoxybenzoic acid 4-pentylphenyl;p-Methoxybenzoic acid p-pentylphenyl ester | | CAS: | 38444-13-2 | | MF: | C19H22O3 | | MW: | 298.38 | | EINECS: | 253-932-7 | | Product Categories: | | | Mol File: | 38444-13-2.mol |  |
| | 4-Amylphenyl 4'-methoyxbenzoate Chemical Properties |
| Melting point | 28-42 °C | | Boiling point | 429.7±38.0 °C(Predicted) | | density | 1.068±0.06 g/cm3(Predicted) | | Fp | 110 °C | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Light yellow | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChI | 1S/C19H22O3/c1-3-4-5-6-15-7-11-18(12-8-15)22-19(20)16-9-13-17(21-2)14-10-16/h7-14H,3-6H2,1-2H3 | | InChIKey | UISXVYOLBGBYCV-UHFFFAOYSA-N | | SMILES | CCCCCc1ccc(OC(=O)c2ccc(OC)cc2)cc1 | | EPA Substance Registry System | Benzoic acid, 4-methoxy-, 4-pentylphenyl ester (38444-13-2) |
| Hazard Codes | Xi,N | | Risk Statements | 36/38-43-50/53 | | Safety Statements | 26-37/39-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2918.99.4700 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4
Skin Sens. 1 |
| | 4-Amylphenyl 4'-methoyxbenzoate Usage And Synthesis |
| | 4-Amylphenyl 4'-methoyxbenzoate Preparation Products And Raw materials |
|