|
|
| | Ethyl cis-2-hydroxy-1-cyclohexanecarboxylate, 98 Basic information |
| Product Name: | Ethyl cis-2-hydroxy-1-cyclohexanecarboxylate, 98 | | Synonyms: | ethyl (1R,2S)-2-hydroxycyclohexane-1-carboxylate;Cis-Ethyl 2-hydroxy-cyclohexanecarboxylate;Cyclohexanecarboxylic acid, 2-hydroxy-, ethyl ester, (1R,2S)-rel-;rel-Ethyl (1R,2S)-2-hydroxycyclohexanecarboxylate;ethyl cis-2-hydroxycyclohexanecarboxylate;rel-Ethyl(1R,2S)-2-hydroxycyclohexane-1-carboxylate;Ethyl cis-2-hydroxy-1-cyclohexanecarboxylate, 98 | | CAS: | 6149-52-6 | | MF: | C9H16O3 | | MW: | 172.22 | | EINECS: | | | Product Categories: | | | Mol File: | 6149-52-6.mol |  |
| | Ethyl cis-2-hydroxy-1-cyclohexanecarboxylate, 98 Chemical Properties |
| Melting point | 77 °C | | Boiling point | 134-135°C/39mmHg | | density | 1.0600 g/cm3(Temp: 25 °C) | | storage temp. | Sealed in dry,Room Temperature | | pka | 14.67±0.40(Predicted) | | InChI | InChI=1/C9H16O3/c1-2-12-9(11)7-5-3-4-6-8(7)10/h7-8,10H,2-6H2,1H3/t7-,8+/s3 | | InChIKey | WOGRTPJVNNCUKN-WWXSATIUNA-N | | SMILES | [C@@H]1(C(OCC)=O)CCCC[C@@H]1O |&1:0,10,r| |
| | Ethyl cis-2-hydroxy-1-cyclohexanecarboxylate, 98 Usage And Synthesis |
| Chemical Properties | clear colorless liquid |
| | Ethyl cis-2-hydroxy-1-cyclohexanecarboxylate, 98 Preparation Products And Raw materials |
|