|
|
| | 2-O-(2-Acetamido-2-doexy-β-D-glucopyrano syl)-D-Man Basic information |
| | 2-O-(2-Acetamido-2-doexy-β-D-glucopyrano syl)-D-Man Chemical Properties |
| Melting point | 141-143°C | | Boiling point | 858.174±65.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.582±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | 2-8°C | | solubility | Methanol (Slightly), Water (Slightly) | | form | powder | | pka | 12.906±0.70(predicted) | | color | Off-White to Pale Beige | | Stability: | Hygroscopic | | InChIKey | WCIQTQUMKQRLKV-ZTGOBPNGSA-N | | SMILES | CC(N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1O[C@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO)=O |
| WGK Germany | 3 | | HS Code | 29400090 |
| | 2-O-(2-Acetamido-2-doexy-β-D-glucopyrano syl)-D-Man Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | A common oligosaccharide that inhibits the adherence of typical and atypical respiratory pathogens | | Definition | ChEBI: Beta-D-GlcpNAc-(1->2)-D-Manp is an amino disaccharide consisting of 2-acetamido-2-deoxy-beta-D-glucopyranose and D-mannopyranose residues joined in sequence by a (1->2) glycosidic bond. It is a glycosylmannose derivative, an amino disaccharide and a member of acetamides. | | Biological Activity | N-Acetyglucosaminyl-beta-1,2-mannose is a common oligosaccharide th at inhibits the adherence of typical and atypical respiratory pathogens. |
| | 2-O-(2-Acetamido-2-doexy-β-D-glucopyrano syl)-D-Man Preparation Products And Raw materials |
|