| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
ER-27319 manufacturers
- ER-27319
-
- $2500.00
-
2026-07-27
- CAS:201010-95-9
- Purity:
- Supply Ability: 10g
|
| | ER-27319 Basic information |
| Product Name: | ER-27319 | | Synonyms: | 10-(3-AMINOPROPYL)-3,4-DIMETHYL-9(10H)-ACRIDINONE MALEATE;ER 27319 MALEATE | | CAS: | 201010-95-9 | | MF: | C22H24N2O5 | | MW: | 396.43636 | | EINECS: | | | Product Categories: | | | Mol File: | 201010-95-9.mol |  |
| | ER-27319 Chemical Properties |
| Melting point | 135 - 137°C | | storage temp. | 2-8°C | | solubility | DMSO: 28 mg/mL | | form | solid | | color | Pale Yellow to Light Yellow | | InChI | 1S/C18H20N2O.C2H2O4/c1-12-8-9-15-17(13(12)2)20(11-5-10-19)16-7-4-3-6-14(16)18(15)21;3-1(4)2(5)6/h3-4,6-9H,5,10-11,19H2,1-2H3;(H,3,4)(H,5,6) | | InChIKey | IIELZHYJYZBSGG-UHFFFAOYSA-N | | SMILES | OC(=O)C(O)=O.Cc1ccc2C(=O)c3ccccc3N(CCCN)c2c1C |
| Hazard Codes | Xn | | Risk Statements | 21/22 | | Safety Statements | 24/25 | | WGK Germany | 1 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Oral |
| | ER-27319 Usage And Synthesis |
| Uses | ER 27319 Maleate is a PLK-1 and Syk inhibitor. | | Biological Activity | Selective inhibitor of Syk kinase. Inhibits tyrosine phosphorylation of Syk initiated by the engagement of Fc ε RI in rat and human mast cells. Results in the abrogation of degranulation, TNF- α production (IC 50 = 10 μ M) and other related signaling events. |
| | ER-27319 Preparation Products And Raw materials |
|