| Company Name: |
Tianjin heowns Biochemical Technology Co., Ltd.
|
| Tel: |
400 638 7771 |
| Email: |
sales@heowns.com |
| Products Intro: |
Product Name:trans-4-[4-(DiMethylaMino)styryl]-MethylpyridiniuM iodide
CAS:68971-03-9
Purity:Dye content 98% Package:1g~500g
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:trans-4-[4-(Dimethylamino)styryl]-1-methylpyridinium iodide
CAS:68971-03-9
Purity:Dye content 98 % Package:1G Remarks:336408-1G
|
| Company Name: |
ShangHai Angti Biotechnology Co., Ltd.
|
| Tel: |
13764913901 |
| Email: |
info@angtibio.com |
| Products Intro: |
Product Name:trans-4-[4-(Dimethylamino)styryl]-1-methylpyridinium iodide
CAS:68971-03-9
|
|
| | TRANS-4-(4-(DIMETHYLAMINO)STYRYL)-1- Basic information |
| Product Name: | TRANS-4-(4-(DIMETHYLAMINO)STYRYL)-1- | | Synonyms: | TRANS-4-(4-(DIMETHYLAMINO)STYRYL)-1-;trans-4-(4-(dimethylamino)styryl)-1-methylpyridin;trans-4-[4-(DiMethylaMino)styryl]-1-MethylpyridiniuM iodide Dye content 98 %;(E)-4-(4-(Dimethylamino)styryl)-1-methylpyridin-1-ium iodide;trans-4-[4-(Dimethylamino)styryl]-1-methylpyridinium iodide;4-2-[4-(dimethylamino)phenyl]ethenyl-1-methylpyridin-1-ium iodide;Diisopropyl-phosphoramidous acid (2R,3S,5R)-2-[bis-(4-methoxy-phenyl)-phenyl-methoxymethyl]-5-naphthalen-1-yl-tetrahydro-furan-3-yl ester 2-cyano-ethyl ester;trans-4-[4-(DiMethylaMino)styryl]-MethylpyridiniuM iodide | | CAS: | 68971-03-9 | | MF: | C16H19IN2 | | MW: | 366.25 | | EINECS: | | | Product Categories: | NLO Chromophores and Intermediates;Non-Linear Optical (NLO) Materials;Photonic and Optical Materials | | Mol File: | 68971-03-9.mol |  |
| | TRANS-4-(4-(DIMETHYLAMINO)STYRYL)-1- Chemical Properties |
| Melting point | 254-256 °C(lit.) | | λmax | 475 nm | | InChI | 1S/C16H19N2.HI/c1-17(2)16-8-6-14(7-9-16)4-5-15-10-12-18(3)13-11-15;/h4-13H,1-3H3;1H/q+1;/p-1 | | InChIKey | UJNFDSOJKNOBIA-UHFFFAOYSA-M | | SMILES | [I-].[H]\C(=C(\[H])c1cc[n+](C)cc1)c2ccc(cc2)N(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | TRANS-4-(4-(DIMETHYLAMINO)STYRYL)-1- Usage And Synthesis |
| Uses | DASP can be used to characterize the fluorescence of zeolite crystals which can further be used in the development of photofunctional materials. | | Definition | ChEBI: 4-[4-(dimethylamino)styryl]-N-methylpyridinium iodide is an organic iodide salt consisting of pyridinium iodide having a methyl substituent at the 1-position and a 4-dimethylaminostyryl substituent at the 4-position. It has a role as a fluorochrome. It is an organic iodide salt and a pyridinium salt. It contains a 4-[4-(dimethylamino)styryl]-N-methylpyridinium. | | General Description | trans-4-[4-(dimethylamino)-styryl]-1-methylpyridinium iodide (DASPI) is a hemicyanine dye. |
| | TRANS-4-(4-(DIMETHYLAMINO)STYRYL)-1- Preparation Products And Raw materials |
|