3-METHYL-1-BUTYLBORONIC ACID manufacturers
|
| | 3-METHYL-1-BUTYLBORONIC ACID Basic information |
| | 3-METHYL-1-BUTYLBORONIC ACID Chemical Properties |
| Melting point | 80-91 °C | | Boiling point | 199.7±23.0 °C(Predicted) | | density | 0.903±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | solid | | pka | 10.37±0.43(Predicted) | | color | White | | InChI | InChI=1S/C5H13BO2/c1-5(2)3-4-6(7)8/h5,7-8H,3-4H2,1-2H3 | | InChIKey | UVMWVBMFEDQYRW-UHFFFAOYSA-N | | SMILES | B(CCC(C)C)(O)O |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29319090 | | Storage Class | 13 - Non Combustible Solids |
| | 3-METHYL-1-BUTYLBORONIC ACID Usage And Synthesis |
| Chemical Properties | solid | | Uses | Reactant for:
- Selective copper-promoted cross-coupling with aromatic amines
- Synthesis of indazole based analog sensitive Akt inhibitors
- Preparation of alkylarenes via tetraphosphine-palladium-catalyzed Suzuki cross-coupling with aryl halides
|
| | 3-METHYL-1-BUTYLBORONIC ACID Preparation Products And Raw materials |
|