|
|
| | 2-NP-AHD Basic information |
| Product Name: | 2-NP-AHD | | Synonyms: | 1-(2-nitrobenzylidenamino)-2,4-imidazolidinedione;NP-AHD2-;1-[[(2-Nitrophenyl)methylene]amino]-2,4-imidazolidinedione;1-[(2-Nitrobenzylidene)-amino]- imidazolidin-2,4-dione-13C,15N3;2-NP-AHD-13C,15N3;1-[[(2-Nitrophenyl)Methylene]aMino]-;2,4-Imidazolidinedione, 1-[[(2-nitrophenyl)methylene]amino]-;2-NP-AHD solution in Methanol, 100μg/mL | | CAS: | 623145-57-3 | | MF: | C10H8N4O4 | | MW: | 248.2 | | EINECS: | | | Product Categories: | Aromatics;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 623145-57-3.mol |  |
| | 2-NP-AHD Chemical Properties |
| Melting point | 220-221°C | | density | 1.58±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly) | | pka | 7.76±0.10(Predicted) | | color | Pale Yellow | | Major Application | clinical testing | | InChI | 1S/C10H8N4O4/c15-9-6-13(10(16)12-9)11-5-7-3-1-2-4-8(7)14(17)18/h1-5H,6H2,(H,12,15,16)/b11-5+ | | InChIKey | FULJCJZKZXOFQZ-VZUCSPMQSA-N | | SMILES | O=C(C1)NC(N1/N=C/C2=C([N+]([O-])=O)C=CC=C2)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 2-NP-AHD Usage And Synthesis |
| Uses | A derivative of the metabolite of nitrofuran antibiotics, 1-aminohydantoin (AH) (A611090).Environmental contaminants; Food contaminants; Heat processing contaminants |
| | 2-NP-AHD Preparation Products And Raw materials |
|