|
|
| | Chlorothalonil-4-hydroxy Basic information |
| Product Name: | Chlorothalonil-4-hydroxy | | Synonyms: | 4-hydroxychlorothalonil;4-hydroxy-2,5,6-trichloro-1,3-benzenedicarbonitrile;4-hydroxy-2,5,6-trichloro-3-benzenedicarbonitrile;4-hydroxy-2,5,6-trichloroisophthalonitrile;1,3-Dicyano-4-hydroxy-2,5,6-trichlorobenzene;2,4,5-Trichloro-6-hydroxy-
isophthalonitrile;2,4,5-Trichloro-6-hydroxy-1,3-benzenedicarbonitrile;2,5,6-Trichloro-4-
hydroxy-1,3-benzenedicarbonitrile | | CAS: | 28343-61-5 | | MF: | C8HCl3N2O | | MW: | 247.47 | | EINECS: | | | Product Categories: | Agro-Products;Aromatics;Metabolites & Impurities;Mutagenesis Research Chemicals | | Mol File: | 28343-61-5.mol |  |
| | Chlorothalonil-4-hydroxy Chemical Properties |
| Melting point | 262-264 °C(Solv: ethanol (64-17-5)) | | Boiling point | 355.0±42.0 °C(Predicted) | | density | 1.75±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 1.67±0.33(Predicted) | | color | Off-White to Pale Beige | | Major Application | agriculture
environmental | | InChI | 1S/C8HCl3N2O/c9-5-3(1-12)6(10)7(11)8(14)4(5)2-13/h14H | | InChIKey | MDQKYGOECVSPIW-UHFFFAOYSA-N | | SMILES | ClC1=C(C#N)C(Cl)=C(Cl)C(O)=C1C#N | | EPA Substance Registry System | 1,3-Benzenedicarbonitrile, 2,4,5-trichloro-6-hydroxy- (28343-61-5) |
| WGK Germany | WGK 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Inhalation
Aquatic Acute 1
Aquatic Chronic 1
Carc. 2
Eye Dam. 1
Skin Sens. 1
STOT SE 3 |
| | Chlorothalonil-4-hydroxy Usage And Synthesis |
| Uses | Hydroxychlorothalonil is a metabolite of Chlorothalonil (C411250). | | Definition | ChEBI: A member of the class of trichlorophenols that is isophthalonitrile substituted at positions 2, 4 and 5 by chloro groups and at position 6 by a hydroxy group. The major metabolite of chlorothalonil. |
| | Chlorothalonil-4-hydroxy Preparation Products And Raw materials |
|